About 2-acetyloxyoctanoic acid
2-acetyloxyoctanoic acid (PubChem CID 22420039) has the molecular formula C10H18O4
and a molecular weight of 202.25 g/mol. Its IUPAC name is 2-acetyloxyoctanoic acid.
Molecular Properties
| Compound Name | 2-acetyloxyoctanoic acid |
| PubChem CID | 22420039 |
| Molecular Formula | C10H18O4 |
| Molecular Weight | 202.25 g/mol |
| Exact Mass | 202.12 |
| IUPAC Name | 2-acetyloxyoctanoic acid |
| SMILES | CCCCCCC(OC(C)=O)C(=O)O |
| InChI | InChI=1S/C10H18O4/c1-3-4-5-6-7-9(10(12)13)14-8(2)11/h9H,3-7H2,1-2H3,(H,12,13) |
| InChIKey | HMUBVMKCIZTMNB-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 202.25 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-acetyloxyoctanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-acetyloxyoctanoic acid?
The IUPAC name of 2-acetyloxyoctanoic acid (CID 22420039) is 2-acetyloxyoctanoic acid.
What is the SMILES notation for 2-acetyloxyoctanoic acid?
The canonical SMILES for 2-acetyloxyoctanoic acid is CCCCCCC(OC(C)=O)C(=O)O.
What is the InChIKey of 2-acetyloxyoctanoic acid?
The InChIKey is HMUBVMKCIZTMNB-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H18O4/c1-3-4-5-6-7-9(10(12)13)14-8(2)11/h9H,3-7H2,1-2H3,(H,12,13).
What are the key properties of 2-acetyloxyoctanoic acid?
2-acetyloxyoctanoic acid has a molecular weight of 202.25 g/mol, XLogP of 1.97, 7 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-acetyloxyoctanoic acid is sourced from PubChem (CID 22420039), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).