C18H36N2O4 — CID 22420379
1-hydroxy-3-(4-hydroxy-2,2,6,6-tetramethylpiperidin-1-yl)oxy-2,2,6,6-tetramethylpiperidin-4-ol (PubChem CID 22420379) has the molecular formula C18H36N2O4 and a molecular weight of 344.50 g/mol. Its IUPAC name is 1-hydroxy-3-(4-hydroxy-2,2,6,6-tetramethylpiperidin-1-yl)oxy-2,2,6,6-tetramethylpiperidin-4-ol.
| Compound Name | 1-hydroxy-3-(4-hydroxy-2,2,6,6-tetramethylpiperidin-1-yl)oxy-2,2,6,6-tetramethylpiperidin-4-ol |
|---|---|
| PubChem CID | 22420379 |
| Molecular Formula | C18H36N2O4 |
| Molecular Weight | 344.50 g/mol |
| Exact Mass | 344.27 |
| IUPAC Name | 1-hydroxy-3-(4-hydroxy-2,2,6,6-tetramethylpiperidin-1-yl)oxy-2,2,6,6-tetramethylpiperidin-4-ol |
| SMILES | CC1(C)CC(O)CC(C)(C)N1OC1C(O)CC(C)(C)N(O)C1(C)C |
| InChI | InChI=1S/C18H36N2O4/c1-15(2)11-13(22)14(18(7,8)19(15)23)24-20-16(3,4)9-12(21)10-17(20,5)6/h12-14,21-23H,9-11H2,1-8H3 |
| InChIKey | AKIDTGMOGJRRIQ-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 76.40 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.50 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |