About 2-[4-(5-tert-butyl-1,3-dithian-2-yl)-2-fluorophenyl]ethynyl-trimethylsilane
2-[4-(5-tert-butyl-1,3-dithian-2-yl)-2-fluorophenyl]ethynyl-trimethylsilane (PubChem CID 22421086) has the molecular formula C19H27FS2Si
and a molecular weight of 366.64 g/mol. Its IUPAC name is 2-[4-(5-tert-butyl-1,3-dithian-2-yl)-2-fluorophenyl]ethynyl-trimethylsilane.
Molecular Properties
| Compound Name | 2-[4-(5-tert-butyl-1,3-dithian-2-yl)-2-fluorophenyl]ethynyl-trimethylsilane |
| PubChem CID | 22421086 |
| Molecular Formula | C19H27FS2Si |
| Molecular Weight | 366.64 g/mol |
| Exact Mass | 366.13 |
| IUPAC Name | 2-[4-(5-tert-butyl-1,3-dithian-2-yl)-2-fluorophenyl]ethynyl-trimethylsilane |
| SMILES | CC(C)(C)C1CSC(c2ccc(C#C[Si](C)(C)C)c(F)c2)SC1 |
| InChI | InChI=1S/C19H27FS2Si/c1-19(2,3)16-12-21-18(22-13-16)15-8-7-14(17(20)11-15)9-10-23(4,5)6/h7-8,11,16,18H,12-13H2,1-6H3 |
| InChIKey | KQFUTGKXFKWFOO-UHFFFAOYSA-N |
| XLogP | 6.20 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 366.64 |
| LogP ≤ 5 | 6.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-[4-(5-tert-butyl-1,3-dithian-2-yl)-2-fluorophenyl]ethynyl-trimethylsilane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[4-(5-tert-butyl-1,3-dithian-2-yl)-2-fluorophenyl]ethynyl-trimethylsilane?
The IUPAC name of 2-[4-(5-tert-butyl-1,3-dithian-2-yl)-2-fluorophenyl]ethynyl-trimethylsilane (CID 22421086) is 2-[4-(5-tert-butyl-1,3-dithian-2-yl)-2-fluorophenyl]ethynyl-trimethylsilane.
What is the SMILES notation for 2-[4-(5-tert-butyl-1,3-dithian-2-yl)-2-fluorophenyl]ethynyl-trimethylsilane?
The canonical SMILES for 2-[4-(5-tert-butyl-1,3-dithian-2-yl)-2-fluorophenyl]ethynyl-trimethylsilane is CC(C)(C)C1CSC(c2ccc(C#C[Si](C)(C)C)c(F)c2)SC1.
What is the InChIKey of 2-[4-(5-tert-butyl-1,3-dithian-2-yl)-2-fluorophenyl]ethynyl-trimethylsilane?
The InChIKey is KQFUTGKXFKWFOO-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H27FS2Si/c1-19(2,3)16-12-21-18(22-13-16)15-8-7-14(17(20)11-15)9-10-23(4,5)6/h7-8,11,16,18H,12-13H2,1-6H3.
What are the key properties of 2-[4-(5-tert-butyl-1,3-dithian-2-yl)-2-fluorophenyl]ethynyl-trimethylsilane?
2-[4-(5-tert-butyl-1,3-dithian-2-yl)-2-fluorophenyl]ethynyl-trimethylsilane has a molecular weight of 366.64 g/mol, XLogP of 6.20, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[4-(5-tert-butyl-1,3-dithian-2-yl)-2-fluorophenyl]ethynyl-trimethylsilane is sourced from PubChem (CID 22421086), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).