About 5-tert-butyl-2-methyl-2-[4-(trifluoromethyl)phenyl]-1,3-dithiane
5-tert-butyl-2-methyl-2-[4-(trifluoromethyl)phenyl]-1,3-dithiane (PubChem CID 22421088) has the molecular formula C16H21F3S2
and a molecular weight of 334.47 g/mol. Its IUPAC name is 5-tert-butyl-2-methyl-2-[4-(trifluoromethyl)phenyl]-1,3-dithiane.
Molecular Properties
| Compound Name | 5-tert-butyl-2-methyl-2-[4-(trifluoromethyl)phenyl]-1,3-dithiane |
| PubChem CID | 22421088 |
| Molecular Formula | C16H21F3S2 |
| Molecular Weight | 334.47 g/mol |
| Exact Mass | 334.10 |
| IUPAC Name | 5-tert-butyl-2-methyl-2-[4-(trifluoromethyl)phenyl]-1,3-dithiane |
| SMILES | CC1(c2ccc(C(F)(F)F)cc2)SCC(C(C)(C)C)CS1 |
| InChI | InChI=1S/C16H21F3S2/c1-14(2,3)13-9-20-15(4,21-10-13)11-5-7-12(8-6-11)16(17,18)19/h5-8,13H,9-10H2,1-4H3 |
| InChIKey | GAZJOQKRZQBWAQ-UHFFFAOYSA-N |
| XLogP | 6.02 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 334.47 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 5-tert-butyl-2-methyl-2-[4-(trifluoromethyl)phenyl]-1,3-dithiane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-tert-butyl-2-methyl-2-[4-(trifluoromethyl)phenyl]-1,3-dithiane?
The IUPAC name of 5-tert-butyl-2-methyl-2-[4-(trifluoromethyl)phenyl]-1,3-dithiane (CID 22421088) is 5-tert-butyl-2-methyl-2-[4-(trifluoromethyl)phenyl]-1,3-dithiane.
What is the SMILES notation for 5-tert-butyl-2-methyl-2-[4-(trifluoromethyl)phenyl]-1,3-dithiane?
The canonical SMILES for 5-tert-butyl-2-methyl-2-[4-(trifluoromethyl)phenyl]-1,3-dithiane is CC1(c2ccc(C(F)(F)F)cc2)SCC(C(C)(C)C)CS1.
What is the InChIKey of 5-tert-butyl-2-methyl-2-[4-(trifluoromethyl)phenyl]-1,3-dithiane?
The InChIKey is GAZJOQKRZQBWAQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H21F3S2/c1-14(2,3)13-9-20-15(4,21-10-13)11-5-7-12(8-6-11)16(17,18)19/h5-8,13H,9-10H2,1-4H3.
What are the key properties of 5-tert-butyl-2-methyl-2-[4-(trifluoromethyl)phenyl]-1,3-dithiane?
5-tert-butyl-2-methyl-2-[4-(trifluoromethyl)phenyl]-1,3-dithiane has a molecular weight of 334.47 g/mol, XLogP of 6.02, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-tert-butyl-2-methyl-2-[4-(trifluoromethyl)phenyl]-1,3-dithiane is sourced from PubChem (CID 22421088), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).