About 2-[2-(2-hydroxypropoxy)propoxy]propan-1-ol;2-penta-1,4-dien-2-yloxypenta-1,4-diene
2-[2-(2-hydroxypropoxy)propoxy]propan-1-ol;2-penta-1,4-dien-2-yloxypenta-1,4-diene (PubChem CID 22421285) has the molecular formula C19H34O5
and a molecular weight of 342.48 g/mol. Its IUPAC name is 2-[2-(2-hydroxypropoxy)propoxy]propan-1-ol;2-penta-1,4-dien-2-yloxypenta-1,4-diene.
Molecular Properties
| Compound Name | 2-[2-(2-hydroxypropoxy)propoxy]propan-1-ol;2-penta-1,4-dien-2-yloxypenta-1,4-diene |
| PubChem CID | 22421285 |
| Molecular Formula | C19H34O5 |
| Molecular Weight | 342.48 g/mol |
| Exact Mass | 342.24 |
| IUPAC Name | 2-[2-(2-hydroxypropoxy)propoxy]propan-1-ol;2-penta-1,4-dien-2-yloxypenta-1,4-diene |
| SMILES | C=CCC(=C)OC(=C)CC=C.CC(O)COC(C)COC(C)CO |
| InChI | InChI=1S/C10H14O.C9H20O4/c1-5-7-9(3)11-10(4)8-6-2;1-7(11)5-12-9(3)6-13-8(2)4-10/h5-6H,1-4,7-8H2;7-11H,4-6H2,1-3H3 |
| InChIKey | HDSTWCYYVUXLFQ-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 68.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 342.48 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2-[2-(2-hydroxypropoxy)propoxy]propan-1-ol;2-penta-1,4-dien-2-yloxypenta-1,4-diene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[2-(2-hydroxypropoxy)propoxy]propan-1-ol;2-penta-1,4-dien-2-yloxypenta-1,4-diene?
The IUPAC name of 2-[2-(2-hydroxypropoxy)propoxy]propan-1-ol;2-penta-1,4-dien-2-yloxypenta-1,4-diene (CID 22421285) is 2-[2-(2-hydroxypropoxy)propoxy]propan-1-ol;2-penta-1,4-dien-2-yloxypenta-1,4-diene.
What is the SMILES notation for 2-[2-(2-hydroxypropoxy)propoxy]propan-1-ol;2-penta-1,4-dien-2-yloxypenta-1,4-diene?
The canonical SMILES for 2-[2-(2-hydroxypropoxy)propoxy]propan-1-ol;2-penta-1,4-dien-2-yloxypenta-1,4-diene is C=CCC(=C)OC(=C)CC=C.CC(O)COC(C)COC(C)CO.
What is the InChIKey of 2-[2-(2-hydroxypropoxy)propoxy]propan-1-ol;2-penta-1,4-dien-2-yloxypenta-1,4-diene?
The InChIKey is HDSTWCYYVUXLFQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H14O.C9H20O4/c1-5-7-9(3)11-10(4)8-6-2;1-7(11)5-12-9(3)6-13-8(2)4-10/h5-6H,1-4,7-8H2;7-11H,4-6H2,1-3H3.
What are the key properties of 2-[2-(2-hydroxypropoxy)propoxy]propan-1-ol;2-penta-1,4-dien-2-yloxypenta-1,4-diene?
2-[2-(2-hydroxypropoxy)propoxy]propan-1-ol;2-penta-1,4-dien-2-yloxypenta-1,4-diene has a molecular weight of 342.48 g/mol, XLogP of 3.35, 13 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2-(2-hydroxypropoxy)propoxy]propan-1-ol;2-penta-1,4-dien-2-yloxypenta-1,4-diene is sourced from PubChem (CID 22421285), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).