C6H9N3O3S3 — CID 22421338
1-[3,3,3-tris(sulfanyl)propyl]-1,3,5-triazinane-2,4,6-trione (PubChem CID 22421338) has the molecular formula C6H9N3O3S3 and a molecular weight of 267.36 g/mol. Its IUPAC name is 1-[3,3,3-tris(sulfanyl)propyl]-1,3,5-triazinane-2,4,6-trione.
| Compound Name | 1-[3,3,3-tris(sulfanyl)propyl]-1,3,5-triazinane-2,4,6-trione |
|---|---|
| PubChem CID | 22421338 |
| Molecular Formula | C6H9N3O3S3 |
| Molecular Weight | 267.36 g/mol |
| Exact Mass | 266.98 |
| IUPAC Name | 1-[3,3,3-tris(sulfanyl)propyl]-1,3,5-triazinane-2,4,6-trione |
| SMILES | O=c1[nH]c(=O)n(CCC(S)(S)S)c(=O)[nH]1 |
| InChI | InChI=1S/C6H9N3O3S3/c10-3-7-4(11)9(5(12)8-3)2-1-6(13,14)15/h13-15H,1-2H2,(H2,7,8,10,11,12) |
| InChIKey | QGHCRDOCLFIJFP-UHFFFAOYSA-N |
| XLogP | -0.94 |
| TPSA | 87.72 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.36 |
| LogP ≤ 5 | -0.94 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|