About N-(2,4-dimethoxyphenyl)-6,7-dimethoxy-2-methyl-1-oxoisoquinoline-4-carboxamide
N-(2,4-dimethoxyphenyl)-6,7-dimethoxy-2-methyl-1-oxoisoquinoline-4-carboxamide (PubChem CID 22422505) has the molecular formula C21H22N2O6
and a molecular weight of 398.42 g/mol. Its IUPAC name is N-(2,4-dimethoxyphenyl)-6,7-dimethoxy-2-methyl-1-oxoisoquinoline-4-carboxamide.
Molecular Properties
| Compound Name | N-(2,4-dimethoxyphenyl)-6,7-dimethoxy-2-methyl-1-oxoisoquinoline-4-carboxamide |
| PubChem CID | 22422505 |
| Molecular Formula | C21H22N2O6 |
| Molecular Weight | 398.42 g/mol |
| Exact Mass | 398.15 |
| IUPAC Name | N-(2,4-dimethoxyphenyl)-6,7-dimethoxy-2-methyl-1-oxoisoquinoline-4-carboxamide |
| SMILES | COc1ccc(NC(=O)c2cn(C)c(=O)c3cc(OC)c(OC)cc23)c(OC)c1 |
| InChI | InChI=1S/C21H22N2O6/c1-23-11-15(13-9-18(28-4)19(29-5)10-14(13)21(23)25)20(24)22-16-7-6-12(26-2)8-17(16)27-3/h6-11H,1-5H3,(H,22,24) |
| InChIKey | IYPVCPZDATYVOL-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 88.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 398.42 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze N-(2,4-dimethoxyphenyl)-6,7-dimethoxy-2-methyl-1-oxoisoquinoline-4-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(2,4-dimethoxyphenyl)-6,7-dimethoxy-2-methyl-1-oxoisoquinoline-4-carboxamide?
The IUPAC name of N-(2,4-dimethoxyphenyl)-6,7-dimethoxy-2-methyl-1-oxoisoquinoline-4-carboxamide (CID 22422505) is N-(2,4-dimethoxyphenyl)-6,7-dimethoxy-2-methyl-1-oxoisoquinoline-4-carboxamide.
What is the SMILES notation for N-(2,4-dimethoxyphenyl)-6,7-dimethoxy-2-methyl-1-oxoisoquinoline-4-carboxamide?
The canonical SMILES for N-(2,4-dimethoxyphenyl)-6,7-dimethoxy-2-methyl-1-oxoisoquinoline-4-carboxamide is COc1ccc(NC(=O)c2cn(C)c(=O)c3cc(OC)c(OC)cc23)c(OC)c1.
What is the InChIKey of N-(2,4-dimethoxyphenyl)-6,7-dimethoxy-2-methyl-1-oxoisoquinoline-4-carboxamide?
The InChIKey is IYPVCPZDATYVOL-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H22N2O6/c1-23-11-15(13-9-18(28-4)19(29-5)10-14(13)21(23)25)20(24)22-16-7-6-12(26-2)8-17(16)27-3/h6-11H,1-5H3,(H,22,24).
What are the key properties of N-(2,4-dimethoxyphenyl)-6,7-dimethoxy-2-methyl-1-oxoisoquinoline-4-carboxamide?
N-(2,4-dimethoxyphenyl)-6,7-dimethoxy-2-methyl-1-oxoisoquinoline-4-carboxamide has a molecular weight of 398.42 g/mol, XLogP of 2.83, 6 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for N-(2,4-dimethoxyphenyl)-6,7-dimethoxy-2-methyl-1-oxoisoquinoline-4-carboxamide is sourced from PubChem (CID 22422505), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).