C24H21N3O3S — CID 22422858
2-[4-(2,4-dioxo-1H-thieno[3,2-d]pyrimidin-3-yl)phenyl]-N-(1,2,3,4-tetrahydronaphthalen-1-yl)acetamide (PubChem CID 22422858) has the molecular formula C24H21N3O3S and a molecular weight of 431.52 g/mol. Its IUPAC name is 2-[4-(2,4-dioxo-1H-thieno[3,2-d]pyrimidin-3-yl)phenyl]-N-(1,2,3,4-tetrahydronaphthalen-1-yl)acetamide.
| Compound Name | 2-[4-(2,4-dioxo-1H-thieno[3,2-d]pyrimidin-3-yl)phenyl]-N-(1,2,3,4-tetrahydronaphthalen-1-yl)acetamide |
|---|---|
| PubChem CID | 22422858 |
| Molecular Formula | C24H21N3O3S |
| Molecular Weight | 431.52 g/mol |
| Exact Mass | 431.13 |
| IUPAC Name | 2-[4-(2,4-dioxo-1H-thieno[3,2-d]pyrimidin-3-yl)phenyl]-N-(1,2,3,4-tetrahydronaphthalen-1-yl)acetamide |
| SMILES | O=C(Cc1ccc(-n2c(=O)[nH]c3ccsc3c2=O)cc1)NC1CCCc2ccccc21 |
| InChI | InChI=1S/C24H21N3O3S/c28-21(25-19-7-3-5-16-4-1-2-6-18(16)19)14-15-8-10-17(11-9-15)27-23(29)22-20(12-13-31-22)26-24(27)30/h1-2,4,6,8-13,19H,3,5,7,14H2,(H,25,28)(H,26,30) |
| InChIKey | XJPDILYCXJHWDD-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 83.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.52 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |