About methyl 2-[1-[(4-fluorophenyl)methyl]-2,4-dioxopyrido[2,3-d]pyrimidin-3-yl]pyridine-3-carboxylate
methyl 2-[1-[(4-fluorophenyl)methyl]-2,4-dioxopyrido[2,3-d]pyrimidin-3-yl]pyridine-3-carboxylate (PubChem CID 22423762) has the molecular formula C21H15FN4O4
and a molecular weight of 406.37 g/mol. Its IUPAC name is methyl 2-[1-[(4-fluorophenyl)methyl]-2,4-dioxopyrido[2,3-d]pyrimidin-3-yl]pyridine-3-carboxylate.
Molecular Properties
| Compound Name | methyl 2-[1-[(4-fluorophenyl)methyl]-2,4-dioxopyrido[2,3-d]pyrimidin-3-yl]pyridine-3-carboxylate |
| PubChem CID | 22423762 |
| Molecular Formula | C21H15FN4O4 |
| Molecular Weight | 406.37 g/mol |
| Exact Mass | 406.11 |
| IUPAC Name | methyl 2-[1-[(4-fluorophenyl)methyl]-2,4-dioxopyrido[2,3-d]pyrimidin-3-yl]pyridine-3-carboxylate |
| SMILES | COC(=O)c1cccnc1-n1c(=O)c2cccnc2n(Cc2ccc(F)cc2)c1=O |
| InChI | InChI=1S/C21H15FN4O4/c1-30-20(28)16-5-3-11-24-18(16)26-19(27)15-4-2-10-23-17(15)25(21(26)29)12-13-6-8-14(22)9-7-13/h2-11H,12H2,1H3 |
| InChIKey | USUZOIRVJVVHRW-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 96.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 406.37 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
Analyze methyl 2-[1-[(4-fluorophenyl)methyl]-2,4-dioxopyrido[2,3-d]pyrimidin-3-yl]pyridine-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-[1-[(4-fluorophenyl)methyl]-2,4-dioxopyrido[2,3-d]pyrimidin-3-yl]pyridine-3-carboxylate?
The IUPAC name of methyl 2-[1-[(4-fluorophenyl)methyl]-2,4-dioxopyrido[2,3-d]pyrimidin-3-yl]pyridine-3-carboxylate (CID 22423762) is methyl 2-[1-[(4-fluorophenyl)methyl]-2,4-dioxopyrido[2,3-d]pyrimidin-3-yl]pyridine-3-carboxylate.
What is the SMILES notation for methyl 2-[1-[(4-fluorophenyl)methyl]-2,4-dioxopyrido[2,3-d]pyrimidin-3-yl]pyridine-3-carboxylate?
The canonical SMILES for methyl 2-[1-[(4-fluorophenyl)methyl]-2,4-dioxopyrido[2,3-d]pyrimidin-3-yl]pyridine-3-carboxylate is COC(=O)c1cccnc1-n1c(=O)c2cccnc2n(Cc2ccc(F)cc2)c1=O.
What is the InChIKey of methyl 2-[1-[(4-fluorophenyl)methyl]-2,4-dioxopyrido[2,3-d]pyrimidin-3-yl]pyridine-3-carboxylate?
The InChIKey is USUZOIRVJVVHRW-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H15FN4O4/c1-30-20(28)16-5-3-11-24-18(16)26-19(27)15-4-2-10-23-17(15)25(21(26)29)12-13-6-8-14(22)9-7-13/h2-11H,12H2,1H3.
What are the key properties of methyl 2-[1-[(4-fluorophenyl)methyl]-2,4-dioxopyrido[2,3-d]pyrimidin-3-yl]pyridine-3-carboxylate?
methyl 2-[1-[(4-fluorophenyl)methyl]-2,4-dioxopyrido[2,3-d]pyrimidin-3-yl]pyridine-3-carboxylate has a molecular weight of 406.37 g/mol, XLogP of 1.92, 4 rotatable bonds, 0 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-[1-[(4-fluorophenyl)methyl]-2,4-dioxopyrido[2,3-d]pyrimidin-3-yl]pyridine-3-carboxylate is sourced from PubChem (CID 22423762), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).