About 8-ethyl-3-phenyl-1,4,8-triazaspiro[4.5]dec-3-ene-2-thione
8-ethyl-3-phenyl-1,4,8-triazaspiro[4.5]dec-3-ene-2-thione (PubChem CID 22424120) has the molecular formula C15H19N3S
and a molecular weight of 273.40 g/mol. Its IUPAC name is 8-ethyl-3-phenyl-1,4,8-triazaspiro[4.5]dec-3-ene-2-thione.
Molecular Properties
| Compound Name | 8-ethyl-3-phenyl-1,4,8-triazaspiro[4.5]dec-3-ene-2-thione |
| PubChem CID | 22424120 |
| Molecular Formula | C15H19N3S |
| Molecular Weight | 273.40 g/mol |
| Exact Mass | 273.13 |
| IUPAC Name | 8-ethyl-3-phenyl-1,4,8-triazaspiro[4.5]dec-3-ene-2-thione |
| SMILES | CCN1CCC2(CC1)N=C(c1ccccc1)C(=S)N2 |
| InChI | InChI=1S/C15H19N3S/c1-2-18-10-8-15(9-11-18)16-13(14(19)17-15)12-6-4-3-5-7-12/h3-7H,2,8-11H2,1H3,(H,17,19) |
| InChIKey | XUVSZJCPUMXTRJ-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 27.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 273.40 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 8-ethyl-3-phenyl-1,4,8-triazaspiro[4.5]dec-3-ene-2-thione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-ethyl-3-phenyl-1,4,8-triazaspiro[4.5]dec-3-ene-2-thione?
The IUPAC name of 8-ethyl-3-phenyl-1,4,8-triazaspiro[4.5]dec-3-ene-2-thione (CID 22424120) is 8-ethyl-3-phenyl-1,4,8-triazaspiro[4.5]dec-3-ene-2-thione.
What is the SMILES notation for 8-ethyl-3-phenyl-1,4,8-triazaspiro[4.5]dec-3-ene-2-thione?
The canonical SMILES for 8-ethyl-3-phenyl-1,4,8-triazaspiro[4.5]dec-3-ene-2-thione is CCN1CCC2(CC1)N=C(c1ccccc1)C(=S)N2.
What is the InChIKey of 8-ethyl-3-phenyl-1,4,8-triazaspiro[4.5]dec-3-ene-2-thione?
The InChIKey is XUVSZJCPUMXTRJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H19N3S/c1-2-18-10-8-15(9-11-18)16-13(14(19)17-15)12-6-4-3-5-7-12/h3-7H,2,8-11H2,1H3,(H,17,19).
What are the key properties of 8-ethyl-3-phenyl-1,4,8-triazaspiro[4.5]dec-3-ene-2-thione?
8-ethyl-3-phenyl-1,4,8-triazaspiro[4.5]dec-3-ene-2-thione has a molecular weight of 273.40 g/mol, XLogP of 2.22, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 8-ethyl-3-phenyl-1,4,8-triazaspiro[4.5]dec-3-ene-2-thione is sourced from PubChem (CID 22424120), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).