C24H27N3O3S2 — CID 22424153
11-acetyl-5-[(3-methylphenyl)methylsulfanyl]-4-(oxolan-2-ylmethyl)-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),5-trien-3-one (PubChem CID 22424153) has the molecular formula C24H27N3O3S2 and a molecular weight of 469.63 g/mol. Its IUPAC name is 11-acetyl-5-[(3-methylphenyl)methylsulfanyl]-4-(oxolan-2-ylmethyl)-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),5-trien-3-one.
| Compound Name | 11-acetyl-5-[(3-methylphenyl)methylsulfanyl]-4-(oxolan-2-ylmethyl)-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),5-trien-3-one |
|---|---|
| PubChem CID | 22424153 |
| Molecular Formula | C24H27N3O3S2 |
| Molecular Weight | 469.63 g/mol |
| Exact Mass | 469.15 |
| IUPAC Name | 11-acetyl-5-[(3-methylphenyl)methylsulfanyl]-4-(oxolan-2-ylmethyl)-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),5-trien-3-one |
| SMILES | CC(=O)N1CCc2c(sc3nc(SCc4cccc(C)c4)n(CC4CCCO4)c(=O)c23)C1 |
| InChI | InChI=1S/C24H27N3O3S2/c1-15-5-3-6-17(11-15)14-31-24-25-22-21(23(29)27(24)12-18-7-4-10-30-18)19-8-9-26(16(2)28)13-20(19)32-22/h3,5-6,11,18H,4,7-10,12-14H2,1-2H3 |
| InChIKey | WSDATFWCUAGKDW-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 64.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.63 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |