C20H19N5O3S — CID 22424252
2-(benzylamino)-N-(2-methoxyethyl)-5-oxo-[1,3,4]thiadiazolo[2,3-b]quinazoline-8-carboxamide (PubChem CID 22424252) has the molecular formula C20H19N5O3S and a molecular weight of 409.47 g/mol. Its IUPAC name is 2-(benzylamino)-N-(2-methoxyethyl)-5-oxo-[1,3,4]thiadiazolo[2,3-b]quinazoline-8-carboxamide.
| Compound Name | 2-(benzylamino)-N-(2-methoxyethyl)-5-oxo-[1,3,4]thiadiazolo[2,3-b]quinazoline-8-carboxamide |
|---|---|
| PubChem CID | 22424252 |
| Molecular Formula | C20H19N5O3S |
| Molecular Weight | 409.47 g/mol |
| Exact Mass | 409.12 |
| IUPAC Name | 2-(benzylamino)-N-(2-methoxyethyl)-5-oxo-[1,3,4]thiadiazolo[2,3-b]quinazoline-8-carboxamide |
| SMILES | COCCNC(=O)c1ccc2c(=O)n3nc(NCc4ccccc4)sc3nc2c1 |
| InChI | InChI=1S/C20H19N5O3S/c1-28-10-9-21-17(26)14-7-8-15-16(11-14)23-20-25(18(15)27)24-19(29-20)22-12-13-5-3-2-4-6-13/h2-8,11H,9-10,12H2,1H3,(H,21,26)(H,22,24) |
| InChIKey | IDXQQLRLDHWBBZ-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 97.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.47 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|