About 1-ethyl-2,2-dioxo-2λ6,1-benzothiazin-4-one
1-ethyl-2,2-dioxo-2λ6,1-benzothiazin-4-one (PubChem CID 22424304) has the molecular formula C10H11NO3S
and a molecular weight of 225.27 g/mol. Its IUPAC name is 1-ethyl-2,2-dioxo-2λ6,1-benzothiazin-4-one.
Molecular Properties
| Compound Name | 1-ethyl-2,2-dioxo-2λ6,1-benzothiazin-4-one |
| PubChem CID | 22424304 |
| Molecular Formula | C10H11NO3S |
| Molecular Weight | 225.27 g/mol |
| Exact Mass | 225.05 |
| IUPAC Name | 1-ethyl-2,2-dioxo-2λ6,1-benzothiazin-4-one |
| SMILES | CCN1c2ccccc2C(=O)CS1(=O)=O |
| InChI | InChI=1S/C10H11NO3S/c1-2-11-9-6-4-3-5-8(9)10(12)7-15(11,13)14/h3-6H,2,7H2,1H3 |
| InChIKey | NFGUPHSBQSPLCC-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 225.27 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-ethyl-2,2-dioxo-2λ6,1-benzothiazin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-ethyl-2,2-dioxo-2λ6,1-benzothiazin-4-one?
The IUPAC name of 1-ethyl-2,2-dioxo-2λ6,1-benzothiazin-4-one (CID 22424304) is 1-ethyl-2,2-dioxo-2λ6,1-benzothiazin-4-one.
What is the SMILES notation for 1-ethyl-2,2-dioxo-2λ6,1-benzothiazin-4-one?
The canonical SMILES for 1-ethyl-2,2-dioxo-2λ6,1-benzothiazin-4-one is CCN1c2ccccc2C(=O)CS1(=O)=O.
What is the InChIKey of 1-ethyl-2,2-dioxo-2λ6,1-benzothiazin-4-one?
The InChIKey is NFGUPHSBQSPLCC-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H11NO3S/c1-2-11-9-6-4-3-5-8(9)10(12)7-15(11,13)14/h3-6H,2,7H2,1H3.
What are the key properties of 1-ethyl-2,2-dioxo-2λ6,1-benzothiazin-4-one?
1-ethyl-2,2-dioxo-2λ6,1-benzothiazin-4-one has a molecular weight of 225.27 g/mol, XLogP of 1.04, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-ethyl-2,2-dioxo-2λ6,1-benzothiazin-4-one is sourced from PubChem (CID 22424304), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).