About 3-(3H-imidazo[4,5-c]pyridin-2-yl)-6-methylchromen-2-one
3-(3H-imidazo[4,5-c]pyridin-2-yl)-6-methylchromen-2-one (PubChem CID 22424483) has the molecular formula C16H11N3O2
and a molecular weight of 277.28 g/mol. Its IUPAC name is 3-(3H-imidazo[4,5-c]pyridin-2-yl)-6-methylchromen-2-one.
Molecular Properties
| Compound Name | 3-(3H-imidazo[4,5-c]pyridin-2-yl)-6-methylchromen-2-one |
| PubChem CID | 22424483 |
| Molecular Formula | C16H11N3O2 |
| Molecular Weight | 277.28 g/mol |
| Exact Mass | 277.09 |
| IUPAC Name | 3-(3H-imidazo[4,5-c]pyridin-2-yl)-6-methylchromen-2-one |
| SMILES | Cc1ccc2oc(=O)c(-c3nc4ccncc4[nH]3)cc2c1 |
| InChI | InChI=1S/C16H11N3O2/c1-9-2-3-14-10(6-9)7-11(16(20)21-14)15-18-12-4-5-17-8-13(12)19-15/h2-8H,1H3,(H,18,19) |
| InChIKey | AFTXOIIKGOXDOT-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 71.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 277.28 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|
Analyze 3-(3H-imidazo[4,5-c]pyridin-2-yl)-6-methylchromen-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(3H-imidazo[4,5-c]pyridin-2-yl)-6-methylchromen-2-one?
The IUPAC name of 3-(3H-imidazo[4,5-c]pyridin-2-yl)-6-methylchromen-2-one (CID 22424483) is 3-(3H-imidazo[4,5-c]pyridin-2-yl)-6-methylchromen-2-one.
What is the SMILES notation for 3-(3H-imidazo[4,5-c]pyridin-2-yl)-6-methylchromen-2-one?
The canonical SMILES for 3-(3H-imidazo[4,5-c]pyridin-2-yl)-6-methylchromen-2-one is Cc1ccc2oc(=O)c(-c3nc4ccncc4[nH]3)cc2c1.
What is the InChIKey of 3-(3H-imidazo[4,5-c]pyridin-2-yl)-6-methylchromen-2-one?
The InChIKey is AFTXOIIKGOXDOT-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H11N3O2/c1-9-2-3-14-10(6-9)7-11(16(20)21-14)15-18-12-4-5-17-8-13(12)19-15/h2-8H,1H3,(H,18,19).
What are the key properties of 3-(3H-imidazo[4,5-c]pyridin-2-yl)-6-methylchromen-2-one?
3-(3H-imidazo[4,5-c]pyridin-2-yl)-6-methylchromen-2-one has a molecular weight of 277.28 g/mol, XLogP of 3.04, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(3H-imidazo[4,5-c]pyridin-2-yl)-6-methylchromen-2-one is sourced from PubChem (CID 22424483), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).