About 3-(4-chlorophenyl)-N,N-dipropyltriazolo[1,5-a]quinazolin-5-amine
3-(4-chlorophenyl)-N,N-dipropyltriazolo[1,5-a]quinazolin-5-amine (PubChem CID 22424551) has the molecular formula C21H22ClN5
and a molecular weight of 379.90 g/mol. Its IUPAC name is 3-(4-chlorophenyl)-N,N-dipropyltriazolo[1,5-a]quinazolin-5-amine.
Molecular Properties
| Compound Name | 3-(4-chlorophenyl)-N,N-dipropyltriazolo[1,5-a]quinazolin-5-amine |
| PubChem CID | 22424551 |
| Molecular Formula | C21H22ClN5 |
| Molecular Weight | 379.90 g/mol |
| Exact Mass | 379.16 |
| IUPAC Name | 3-(4-chlorophenyl)-N,N-dipropyltriazolo[1,5-a]quinazolin-5-amine |
| SMILES | CCCN(CCC)c1nc2c(-c3ccc(Cl)cc3)nnn2c2ccccc12 |
| InChI | InChI=1S/C21H22ClN5/c1-3-13-26(14-4-2)20-17-7-5-6-8-18(17)27-21(23-20)19(24-25-27)15-9-11-16(22)12-10-15/h5-12H,3-4,13-14H2,1-2H3 |
| InChIKey | HSIZAOCGADJUQM-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 46.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 379.90 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 3-(4-chlorophenyl)-N,N-dipropyltriazolo[1,5-a]quinazolin-5-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(4-chlorophenyl)-N,N-dipropyltriazolo[1,5-a]quinazolin-5-amine?
The IUPAC name of 3-(4-chlorophenyl)-N,N-dipropyltriazolo[1,5-a]quinazolin-5-amine (CID 22424551) is 3-(4-chlorophenyl)-N,N-dipropyltriazolo[1,5-a]quinazolin-5-amine.
What is the SMILES notation for 3-(4-chlorophenyl)-N,N-dipropyltriazolo[1,5-a]quinazolin-5-amine?
The canonical SMILES for 3-(4-chlorophenyl)-N,N-dipropyltriazolo[1,5-a]quinazolin-5-amine is CCCN(CCC)c1nc2c(-c3ccc(Cl)cc3)nnn2c2ccccc12.
What is the InChIKey of 3-(4-chlorophenyl)-N,N-dipropyltriazolo[1,5-a]quinazolin-5-amine?
The InChIKey is HSIZAOCGADJUQM-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H22ClN5/c1-3-13-26(14-4-2)20-17-7-5-6-8-18(17)27-21(23-20)19(24-25-27)15-9-11-16(22)12-10-15/h5-12H,3-4,13-14H2,1-2H3.
What are the key properties of 3-(4-chlorophenyl)-N,N-dipropyltriazolo[1,5-a]quinazolin-5-amine?
3-(4-chlorophenyl)-N,N-dipropyltriazolo[1,5-a]quinazolin-5-amine has a molecular weight of 379.90 g/mol, XLogP of 5.22, 6 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(4-chlorophenyl)-N,N-dipropyltriazolo[1,5-a]quinazolin-5-amine is sourced from PubChem (CID 22424551), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).