C25H23ClN6O2S2 — CID 22424733
7-[4-(4-chlorophenyl)piperazin-1-yl]-10-(4-ethylphenyl)sulfonyl-5-thia-1,8,11,12-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,7,9,11-pentaene (PubChem CID 22424733) has the molecular formula C25H23ClN6O2S2 and a molecular weight of 539.09 g/mol. Its IUPAC name is 7-[4-(4-chlorophenyl)piperazin-1-yl]-10-(4-ethylphenyl)sulfonyl-5-thia-1,8,11,12-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,7,9,11-pentaene.
| Compound Name | 7-[4-(4-chlorophenyl)piperazin-1-yl]-10-(4-ethylphenyl)sulfonyl-5-thia-1,8,11,12-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,7,9,11-pentaene |
|---|---|
| PubChem CID | 22424733 |
| Molecular Formula | C25H23ClN6O2S2 |
| Molecular Weight | 539.09 g/mol |
| Exact Mass | 538.10 |
| IUPAC Name | 7-[4-(4-chlorophenyl)piperazin-1-yl]-10-(4-ethylphenyl)sulfonyl-5-thia-1,8,11,12-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,7,9,11-pentaene |
| SMILES | CCc1ccc(S(=O)(=O)c2nnn3c2nc(N2CCN(c4ccc(Cl)cc4)CC2)c2sccc23)cc1 |
| InChI | InChI=1S/C25H23ClN6O2S2/c1-2-17-3-9-20(10-4-17)36(33,34)25-24-27-23(22-21(11-16-35-22)32(24)29-28-25)31-14-12-30(13-15-31)19-7-5-18(26)6-8-19/h3-11,16H,2,12-15H2,1H3 |
| InChIKey | MUUZGGKTBVYDDP-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 83.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.09 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |