C16H12ClNO4S — CID 22425128
7-chloro-3-(3-methoxyphenyl)sulfonyl-1H-quinolin-4-one (PubChem CID 22425128) has the molecular formula C16H12ClNO4S and a molecular weight of 349.80 g/mol. Its IUPAC name is 7-chloro-3-(3-methoxyphenyl)sulfonyl-1H-quinolin-4-one.
| Compound Name | 7-chloro-3-(3-methoxyphenyl)sulfonyl-1H-quinolin-4-one |
|---|---|
| PubChem CID | 22425128 |
| Molecular Formula | C16H12ClNO4S |
| Molecular Weight | 349.80 g/mol |
| Exact Mass | 349.02 |
| IUPAC Name | 7-chloro-3-(3-methoxyphenyl)sulfonyl-1H-quinolin-4-one |
| SMILES | COc1cccc(S(=O)(=O)c2c[nH]c3cc(Cl)ccc3c2=O)c1 |
| InChI | InChI=1S/C16H12ClNO4S/c1-22-11-3-2-4-12(8-11)23(20,21)15-9-18-14-7-10(17)5-6-13(14)16(15)19/h2-9H,1H3,(H,18,19) |
| InChIKey | DLVFUWYNNRPXPH-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 76.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.80 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |