C25H21NO5 — CID 22426269
9-(2,4-dimethoxyphenyl)-4-phenyl-8,10-dihydropyrano[2,3-f][1,3]benzoxazin-2-one (PubChem CID 22426269) has the molecular formula C25H21NO5 and a molecular weight of 415.45 g/mol. Its IUPAC name is 9-(2,4-dimethoxyphenyl)-4-phenyl-8,10-dihydropyrano[2,3-f][1,3]benzoxazin-2-one.
| Compound Name | 9-(2,4-dimethoxyphenyl)-4-phenyl-8,10-dihydropyrano[2,3-f][1,3]benzoxazin-2-one |
|---|---|
| PubChem CID | 22426269 |
| Molecular Formula | C25H21NO5 |
| Molecular Weight | 415.45 g/mol |
| Exact Mass | 415.14 |
| IUPAC Name | 9-(2,4-dimethoxyphenyl)-4-phenyl-8,10-dihydropyrano[2,3-f][1,3]benzoxazin-2-one |
| SMILES | COc1ccc(N2COc3ccc4c(-c5ccccc5)cc(=O)oc4c3C2)c(OC)c1 |
| InChI | InChI=1S/C25H21NO5/c1-28-17-8-10-21(23(12-17)29-2)26-14-20-22(30-15-26)11-9-18-19(13-24(27)31-25(18)20)16-6-4-3-5-7-16/h3-13H,14-15H2,1-2H3 |
| InChIKey | WSECNJUTLPTIIN-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 61.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.45 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|