C15H16Cl2N2O — CID 22428749
3-(3,4-dichlorophenyl)-8-methyl-1,4-diazaspiro[4.5]dec-3-en-2-one (PubChem CID 22428749) has the molecular formula C15H16Cl2N2O and a molecular weight of 311.21 g/mol. Its IUPAC name is 3-(3,4-dichlorophenyl)-8-methyl-1,4-diazaspiro[4.5]dec-3-en-2-one.
| Compound Name | 3-(3,4-dichlorophenyl)-8-methyl-1,4-diazaspiro[4.5]dec-3-en-2-one |
|---|---|
| PubChem CID | 22428749 |
| Molecular Formula | C15H16Cl2N2O |
| Molecular Weight | 311.21 g/mol |
| Exact Mass | 310.06 |
| IUPAC Name | 3-(3,4-dichlorophenyl)-8-methyl-1,4-diazaspiro[4.5]dec-3-en-2-one |
| SMILES | CC1CCC2(CC1)N=C(c1ccc(Cl)c(Cl)c1)C(=O)N2 |
| InChI | InChI=1S/C15H16Cl2N2O/c1-9-4-6-15(7-5-9)18-13(14(20)19-15)10-2-3-11(16)12(17)8-10/h2-3,8-9H,4-7H2,1H3,(H,19,20) |
| InChIKey | MCVPJZAXPXGCBS-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 41.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.21 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |