C30H36N4O4 — CID 22429951
4-[1-[2-[2-(cyclohexen-1-yl)ethylamino]-2-oxoethyl]-2,4-dioxoquinazolin-3-yl]-N-[(4-methylphenyl)methyl]butanamide (PubChem CID 22429951) has the molecular formula C30H36N4O4 and a molecular weight of 516.64 g/mol. Its IUPAC name is 4-[1-[2-[2-(cyclohexen-1-yl)ethylamino]-2-oxoethyl]-2,4-dioxoquinazolin-3-yl]-N-[(4-methylphenyl)methyl]butanamide.
| Compound Name | 4-[1-[2-[2-(cyclohexen-1-yl)ethylamino]-2-oxoethyl]-2,4-dioxoquinazolin-3-yl]-N-[(4-methylphenyl)methyl]butanamide |
|---|---|
| PubChem CID | 22429951 |
| Molecular Formula | C30H36N4O4 |
| Molecular Weight | 516.64 g/mol |
| Exact Mass | 516.27 |
| IUPAC Name | 4-[1-[2-[2-(cyclohexen-1-yl)ethylamino]-2-oxoethyl]-2,4-dioxoquinazolin-3-yl]-N-[(4-methylphenyl)methyl]butanamide |
| SMILES | Cc1ccc(CNC(=O)CCCn2c(=O)c3ccccc3n(CC(=O)NCCC3=CCCCC3)c2=O)cc1 |
| InChI | InChI=1S/C30H36N4O4/c1-22-13-15-24(16-14-22)20-32-27(35)12-7-19-33-29(37)25-10-5-6-11-26(25)34(30(33)38)21-28(36)31-18-17-23-8-3-2-4-9-23/h5-6,8,10-11,13-16H,2-4,7,9,12,17-21H2,1H3,(H,31,36)(H,32,35) |
| InChIKey | BGHHNRJPRSYAPK-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 102.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.64 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|