About 1-[2-(3,4-diethoxyphenyl)ethyl]-3-[2-(trifluoromethyl)phenyl]urea
1-[2-(3,4-diethoxyphenyl)ethyl]-3-[2-(trifluoromethyl)phenyl]urea (PubChem CID 22430328) has the molecular formula C20H23F3N2O3
and a molecular weight of 396.41 g/mol. Its IUPAC name is 1-[2-(3,4-diethoxyphenyl)ethyl]-3-[2-(trifluoromethyl)phenyl]urea.
Molecular Properties
| Compound Name | 1-[2-(3,4-diethoxyphenyl)ethyl]-3-[2-(trifluoromethyl)phenyl]urea |
| PubChem CID | 22430328 |
| Molecular Formula | C20H23F3N2O3 |
| Molecular Weight | 396.41 g/mol |
| Exact Mass | 396.17 |
| IUPAC Name | 1-[2-(3,4-diethoxyphenyl)ethyl]-3-[2-(trifluoromethyl)phenyl]urea |
| SMILES | CCOc1ccc(CCNC(=O)Nc2ccccc2C(F)(F)F)cc1OCC |
| InChI | InChI=1S/C20H23F3N2O3/c1-3-27-17-10-9-14(13-18(17)28-4-2)11-12-24-19(26)25-16-8-6-5-7-15(16)20(21,22)23/h5-10,13H,3-4,11-12H2,1-2H3,(H2,24,25,26) |
| InChIKey | NQXOXVXQNJVBSX-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 396.41 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-[2-(3,4-diethoxyphenyl)ethyl]-3-[2-(trifluoromethyl)phenyl]urea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[2-(3,4-diethoxyphenyl)ethyl]-3-[2-(trifluoromethyl)phenyl]urea?
The IUPAC name of 1-[2-(3,4-diethoxyphenyl)ethyl]-3-[2-(trifluoromethyl)phenyl]urea (CID 22430328) is 1-[2-(3,4-diethoxyphenyl)ethyl]-3-[2-(trifluoromethyl)phenyl]urea.
What is the SMILES notation for 1-[2-(3,4-diethoxyphenyl)ethyl]-3-[2-(trifluoromethyl)phenyl]urea?
The canonical SMILES for 1-[2-(3,4-diethoxyphenyl)ethyl]-3-[2-(trifluoromethyl)phenyl]urea is CCOc1ccc(CCNC(=O)Nc2ccccc2C(F)(F)F)cc1OCC.
What is the InChIKey of 1-[2-(3,4-diethoxyphenyl)ethyl]-3-[2-(trifluoromethyl)phenyl]urea?
The InChIKey is NQXOXVXQNJVBSX-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H23F3N2O3/c1-3-27-17-10-9-14(13-18(17)28-4-2)11-12-24-19(26)25-16-8-6-5-7-15(16)20(21,22)23/h5-10,13H,3-4,11-12H2,1-2H3,(H2,24,25,26).
What are the key properties of 1-[2-(3,4-diethoxyphenyl)ethyl]-3-[2-(trifluoromethyl)phenyl]urea?
1-[2-(3,4-diethoxyphenyl)ethyl]-3-[2-(trifluoromethyl)phenyl]urea has a molecular weight of 396.41 g/mol, XLogP of 4.87, 8 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[2-(3,4-diethoxyphenyl)ethyl]-3-[2-(trifluoromethyl)phenyl]urea is sourced from PubChem (CID 22430328), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).