C19H19ClN2O3S — CID 22430774
4-chloro-N-[2-(7,8-dimethyl-2-oxo-1H-quinolin-3-yl)ethyl]benzenesulfonamide (PubChem CID 22430774) has the molecular formula C19H19ClN2O3S and a molecular weight of 390.89 g/mol. Its IUPAC name is 4-chloro-N-[2-(7,8-dimethyl-2-oxo-1H-quinolin-3-yl)ethyl]benzenesulfonamide.
| Compound Name | 4-chloro-N-[2-(7,8-dimethyl-2-oxo-1H-quinolin-3-yl)ethyl]benzenesulfonamide |
|---|---|
| PubChem CID | 22430774 |
| Molecular Formula | C19H19ClN2O3S |
| Molecular Weight | 390.89 g/mol |
| Exact Mass | 390.08 |
| IUPAC Name | 4-chloro-N-[2-(7,8-dimethyl-2-oxo-1H-quinolin-3-yl)ethyl]benzenesulfonamide |
| SMILES | Cc1ccc2cc(CCNS(=O)(=O)c3ccc(Cl)cc3)c(=O)[nH]c2c1C |
| InChI | InChI=1S/C19H19ClN2O3S/c1-12-3-4-14-11-15(19(23)22-18(14)13(12)2)9-10-21-26(24,25)17-7-5-16(20)6-8-17/h3-8,11,21H,9-10H2,1-2H3,(H,22,23) |
| InChIKey | VBJYBVUOFCTQPN-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 79.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.89 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |