C31H42N4O4 — CID 22430994
2,3-diethoxy-N-[3-(4-ethylpiperazin-1-yl)propyl]-8-oxo-5,6,13,13a-tetrahydroisoquinolino[2,1-b]isoquinoline-13-carboxamide (PubChem CID 22430994) has the molecular formula C31H42N4O4 and a molecular weight of 534.70 g/mol. Its IUPAC name is 2,3-diethoxy-N-[3-(4-ethylpiperazin-1-yl)propyl]-8-oxo-5,6,13,13a-tetrahydroisoquinolino[2,1-b]isoquinoline-13-carboxamide.
| Compound Name | 2,3-diethoxy-N-[3-(4-ethylpiperazin-1-yl)propyl]-8-oxo-5,6,13,13a-tetrahydroisoquinolino[2,1-b]isoquinoline-13-carboxamide |
|---|---|
| PubChem CID | 22430994 |
| Molecular Formula | C31H42N4O4 |
| Molecular Weight | 534.70 g/mol |
| Exact Mass | 534.32 |
| IUPAC Name | 2,3-diethoxy-N-[3-(4-ethylpiperazin-1-yl)propyl]-8-oxo-5,6,13,13a-tetrahydroisoquinolino[2,1-b]isoquinoline-13-carboxamide |
| SMILES | CCOc1cc2c(cc1OCC)C1C(C(=O)NCCCN3CCN(CC)CC3)c3ccccc3C(=O)N1CC2 |
| InChI | InChI=1S/C31H42N4O4/c1-4-33-16-18-34(19-17-33)14-9-13-32-30(36)28-23-10-7-8-11-24(23)31(37)35-15-12-22-20-26(38-5-2)27(39-6-3)21-25(22)29(28)35/h7-8,10-11,20-21,28-29H,4-6,9,12-19H2,1-3H3,(H,32,36) |
| InChIKey | SPXLOTSDYPBALC-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 74.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.70 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|