C17H14ClNO4 — CID 22431239
N-(2-chlorophenyl)-4-(3-methoxyphenyl)-2,4-dioxobutanamide (PubChem CID 22431239) has the molecular formula C17H14ClNO4 and a molecular weight of 331.76 g/mol. Its IUPAC name is N-(2-chlorophenyl)-4-(3-methoxyphenyl)-2,4-dioxobutanamide.
| Compound Name | N-(2-chlorophenyl)-4-(3-methoxyphenyl)-2,4-dioxobutanamide |
|---|---|
| PubChem CID | 22431239 |
| Molecular Formula | C17H14ClNO4 |
| Molecular Weight | 331.76 g/mol |
| Exact Mass | 331.06 |
| IUPAC Name | N-(2-chlorophenyl)-4-(3-methoxyphenyl)-2,4-dioxobutanamide |
| SMILES | COc1cccc(C(=O)CC(=O)C(=O)Nc2ccccc2Cl)c1 |
| InChI | InChI=1S/C17H14ClNO4/c1-23-12-6-4-5-11(9-12)15(20)10-16(21)17(22)19-14-8-3-2-7-13(14)18/h2-9H,10H2,1H3,(H,19,22) |
| InChIKey | DZEXAUVRLHJFDP-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.76 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|