About 4-bromo-N-(1,3-dimethyl-2-oxobenzimidazol-5-yl)cyclopenta-1,3-diene-1-sulfonamide
4-bromo-N-(1,3-dimethyl-2-oxobenzimidazol-5-yl)cyclopenta-1,3-diene-1-sulfonamide (PubChem CID 22431556) has the molecular formula C14H14BrN3O3S
and a molecular weight of 384.26 g/mol. Its IUPAC name is 4-bromo-N-(1,3-dimethyl-2-oxobenzimidazol-5-yl)cyclopenta-1,3-diene-1-sulfonamide.
Molecular Properties
| Compound Name | 4-bromo-N-(1,3-dimethyl-2-oxobenzimidazol-5-yl)cyclopenta-1,3-diene-1-sulfonamide |
| PubChem CID | 22431556 |
| Molecular Formula | C14H14BrN3O3S |
| Molecular Weight | 384.26 g/mol |
| Exact Mass | 382.99 |
| IUPAC Name | 4-bromo-N-(1,3-dimethyl-2-oxobenzimidazol-5-yl)cyclopenta-1,3-diene-1-sulfonamide |
| SMILES | Cn1c(=O)n(C)c2cc(NS(=O)(=O)C3=CC=C(Br)C3)ccc21 |
| InChI | InChI=1S/C14H14BrN3O3S/c1-17-12-6-4-10(8-13(12)18(2)14(17)19)16-22(20,21)11-5-3-9(15)7-11/h3-6,8,16H,7H2,1-2H3 |
| InChIKey | PUAIVCASISTYNT-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 73.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 384.26 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4-bromo-N-(1,3-dimethyl-2-oxobenzimidazol-5-yl)cyclopenta-1,3-diene-1-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-bromo-N-(1,3-dimethyl-2-oxobenzimidazol-5-yl)cyclopenta-1,3-diene-1-sulfonamide?
The IUPAC name of 4-bromo-N-(1,3-dimethyl-2-oxobenzimidazol-5-yl)cyclopenta-1,3-diene-1-sulfonamide (CID 22431556) is 4-bromo-N-(1,3-dimethyl-2-oxobenzimidazol-5-yl)cyclopenta-1,3-diene-1-sulfonamide.
What is the SMILES notation for 4-bromo-N-(1,3-dimethyl-2-oxobenzimidazol-5-yl)cyclopenta-1,3-diene-1-sulfonamide?
The canonical SMILES for 4-bromo-N-(1,3-dimethyl-2-oxobenzimidazol-5-yl)cyclopenta-1,3-diene-1-sulfonamide is Cn1c(=O)n(C)c2cc(NS(=O)(=O)C3=CC=C(Br)C3)ccc21.
What is the InChIKey of 4-bromo-N-(1,3-dimethyl-2-oxobenzimidazol-5-yl)cyclopenta-1,3-diene-1-sulfonamide?
The InChIKey is PUAIVCASISTYNT-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H14BrN3O3S/c1-17-12-6-4-10(8-13(12)18(2)14(17)19)16-22(20,21)11-5-3-9(15)7-11/h3-6,8,16H,7H2,1-2H3.
What are the key properties of 4-bromo-N-(1,3-dimethyl-2-oxobenzimidazol-5-yl)cyclopenta-1,3-diene-1-sulfonamide?
4-bromo-N-(1,3-dimethyl-2-oxobenzimidazol-5-yl)cyclopenta-1,3-diene-1-sulfonamide has a molecular weight of 384.26 g/mol, XLogP of 2.19, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-bromo-N-(1,3-dimethyl-2-oxobenzimidazol-5-yl)cyclopenta-1,3-diene-1-sulfonamide is sourced from PubChem (CID 22431556), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).