C14H14IN5 — CID 22431833
2-ethyl-N-(4-iodophenyl)-5-methyl-[1,2,4]triazolo[1,5-a]pyrimidin-7-amine (PubChem CID 22431833) has the molecular formula C14H14IN5 and a molecular weight of 379.21 g/mol. Its IUPAC name is 2-ethyl-N-(4-iodophenyl)-5-methyl-[1,2,4]triazolo[1,5-a]pyrimidin-7-amine.
| Compound Name | 2-ethyl-N-(4-iodophenyl)-5-methyl-[1,2,4]triazolo[1,5-a]pyrimidin-7-amine |
|---|---|
| PubChem CID | 22431833 |
| Molecular Formula | C14H14IN5 |
| Molecular Weight | 379.21 g/mol |
| Exact Mass | 379.03 |
| IUPAC Name | 2-ethyl-N-(4-iodophenyl)-5-methyl-[1,2,4]triazolo[1,5-a]pyrimidin-7-amine |
| SMILES | CCc1nc2nc(C)cc(Nc3ccc(I)cc3)n2n1 |
| InChI | InChI=1S/C14H14IN5/c1-3-12-18-14-16-9(2)8-13(20(14)19-12)17-11-6-4-10(15)5-7-11/h4-8,17H,3H2,1-2H3 |
| InChIKey | YEGUTCXBSDUCSP-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 55.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.21 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|