C16H13N5O — CID 22432672
N-(4-methoxyphenyl)-[1,2,4]triazolo[3,4-a]phthalazin-6-amine (PubChem CID 22432672) has the molecular formula C16H13N5O and a molecular weight of 291.31 g/mol. Its IUPAC name is N-(4-methoxyphenyl)-[1,2,4]triazolo[3,4-a]phthalazin-6-amine.
| Compound Name | N-(4-methoxyphenyl)-[1,2,4]triazolo[3,4-a]phthalazin-6-amine |
|---|---|
| PubChem CID | 22432672 |
| Molecular Formula | C16H13N5O |
| Molecular Weight | 291.31 g/mol |
| Exact Mass | 291.11 |
| IUPAC Name | N-(4-methoxyphenyl)-[1,2,4]triazolo[3,4-a]phthalazin-6-amine |
| SMILES | COc1ccc(Nc2nn3cnnc3c3ccccc23)cc1 |
| InChI | InChI=1S/C16H13N5O/c1-22-12-8-6-11(7-9-12)18-15-13-4-2-3-5-14(13)16-19-17-10-21(16)20-15/h2-10H,1H3,(H,18,20) |
| InChIKey | XBXRQEHITXGOAT-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 64.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.31 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |