C23H20ClN3O3 — CID 22432817
N-[(4-chlorophenyl)-(5-phenyl-1,3,4-oxadiazol-2-yl)methyl]-3,4-dimethoxyaniline (PubChem CID 22432817) has the molecular formula C23H20ClN3O3 and a molecular weight of 421.88 g/mol. Its IUPAC name is N-[(4-chlorophenyl)-(5-phenyl-1,3,4-oxadiazol-2-yl)methyl]-3,4-dimethoxyaniline.
| Compound Name | N-[(4-chlorophenyl)-(5-phenyl-1,3,4-oxadiazol-2-yl)methyl]-3,4-dimethoxyaniline |
|---|---|
| PubChem CID | 22432817 |
| Molecular Formula | C23H20ClN3O3 |
| Molecular Weight | 421.88 g/mol |
| Exact Mass | 421.12 |
| IUPAC Name | N-[(4-chlorophenyl)-(5-phenyl-1,3,4-oxadiazol-2-yl)methyl]-3,4-dimethoxyaniline |
| SMILES | COc1ccc(NC(c2ccc(Cl)cc2)c2nnc(-c3ccccc3)o2)cc1OC |
| InChI | InChI=1S/C23H20ClN3O3/c1-28-19-13-12-18(14-20(19)29-2)25-21(15-8-10-17(24)11-9-15)23-27-26-22(30-23)16-6-4-3-5-7-16/h3-14,21,25H,1-2H3 |
| InChIKey | ZDLACXRYGRNNJC-UHFFFAOYSA-N |
| XLogP | 5.61 |
| TPSA | 69.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.88 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|