About 1-(3-chlorophenyl)-3-(2,4-dioxo-1H-pyrimidin-5-yl)urea
1-(3-chlorophenyl)-3-(2,4-dioxo-1H-pyrimidin-5-yl)urea (PubChem CID 22433670) has the molecular formula C11H9ClN4O3
and a molecular weight of 280.67 g/mol. Its IUPAC name is 1-(3-chlorophenyl)-3-(2,4-dioxo-1H-pyrimidin-5-yl)urea.
Molecular Properties
| Compound Name | 1-(3-chlorophenyl)-3-(2,4-dioxo-1H-pyrimidin-5-yl)urea |
| PubChem CID | 22433670 |
| Molecular Formula | C11H9ClN4O3 |
| Molecular Weight | 280.67 g/mol |
| Exact Mass | 280.04 |
| IUPAC Name | 1-(3-chlorophenyl)-3-(2,4-dioxo-1H-pyrimidin-5-yl)urea |
| SMILES | O=C(Nc1cccc(Cl)c1)Nc1c[nH]c(=O)[nH]c1=O |
| InChI | InChI=1S/C11H9ClN4O3/c12-6-2-1-3-7(4-6)14-11(19)15-8-5-13-10(18)16-9(8)17/h1-5H,(H2,14,15,19)(H2,13,16,17,18) |
| InChIKey | AVTGCIMHLRJHJD-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 106.85 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 280.67 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-(3-chlorophenyl)-3-(2,4-dioxo-1H-pyrimidin-5-yl)urea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(3-chlorophenyl)-3-(2,4-dioxo-1H-pyrimidin-5-yl)urea?
The IUPAC name of 1-(3-chlorophenyl)-3-(2,4-dioxo-1H-pyrimidin-5-yl)urea (CID 22433670) is 1-(3-chlorophenyl)-3-(2,4-dioxo-1H-pyrimidin-5-yl)urea.
What is the SMILES notation for 1-(3-chlorophenyl)-3-(2,4-dioxo-1H-pyrimidin-5-yl)urea?
The canonical SMILES for 1-(3-chlorophenyl)-3-(2,4-dioxo-1H-pyrimidin-5-yl)urea is O=C(Nc1cccc(Cl)c1)Nc1c[nH]c(=O)[nH]c1=O.
What is the InChIKey of 1-(3-chlorophenyl)-3-(2,4-dioxo-1H-pyrimidin-5-yl)urea?
The InChIKey is AVTGCIMHLRJHJD-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H9ClN4O3/c12-6-2-1-3-7(4-6)14-11(19)15-8-5-13-10(18)16-9(8)17/h1-5H,(H2,14,15,19)(H2,13,16,17,18).
What are the key properties of 1-(3-chlorophenyl)-3-(2,4-dioxo-1H-pyrimidin-5-yl)urea?
1-(3-chlorophenyl)-3-(2,4-dioxo-1H-pyrimidin-5-yl)urea has a molecular weight of 280.67 g/mol, XLogP of 1.36, 2 rotatable bonds, 4 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(3-chlorophenyl)-3-(2,4-dioxo-1H-pyrimidin-5-yl)urea is sourced from PubChem (CID 22433670), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).