About 1-[4-(cyclohexen-1-yl)-1,3-dimethylpyrazol-5-yl]-3-(3-fluorophenyl)urea
1-[4-(cyclohexen-1-yl)-1,3-dimethylpyrazol-5-yl]-3-(3-fluorophenyl)urea (PubChem CID 22434474) has the molecular formula C18H21FN4O
and a molecular weight of 328.39 g/mol. Its IUPAC name is 1-[4-(cyclohexen-1-yl)-1,3-dimethylpyrazol-5-yl]-3-(3-fluorophenyl)urea.
Molecular Properties
| Compound Name | 1-[4-(cyclohexen-1-yl)-1,3-dimethylpyrazol-5-yl]-3-(3-fluorophenyl)urea |
| PubChem CID | 22434474 |
| Molecular Formula | C18H21FN4O |
| Molecular Weight | 328.39 g/mol |
| Exact Mass | 328.17 |
| IUPAC Name | 1-[4-(cyclohexen-1-yl)-1,3-dimethylpyrazol-5-yl]-3-(3-fluorophenyl)urea |
| SMILES | Cc1nn(C)c(NC(=O)Nc2cccc(F)c2)c1C1=CCCCC1 |
| InChI | InChI=1S/C18H21FN4O/c1-12-16(13-7-4-3-5-8-13)17(23(2)22-12)21-18(24)20-15-10-6-9-14(19)11-15/h6-7,9-11H,3-5,8H2,1-2H3,(H2,20,21,24) |
| InChIKey | RLMYOQZANYDDEJ-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 58.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 328.39 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-[4-(cyclohexen-1-yl)-1,3-dimethylpyrazol-5-yl]-3-(3-fluorophenyl)urea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[4-(cyclohexen-1-yl)-1,3-dimethylpyrazol-5-yl]-3-(3-fluorophenyl)urea?
The IUPAC name of 1-[4-(cyclohexen-1-yl)-1,3-dimethylpyrazol-5-yl]-3-(3-fluorophenyl)urea (CID 22434474) is 1-[4-(cyclohexen-1-yl)-1,3-dimethylpyrazol-5-yl]-3-(3-fluorophenyl)urea.
What is the SMILES notation for 1-[4-(cyclohexen-1-yl)-1,3-dimethylpyrazol-5-yl]-3-(3-fluorophenyl)urea?
The canonical SMILES for 1-[4-(cyclohexen-1-yl)-1,3-dimethylpyrazol-5-yl]-3-(3-fluorophenyl)urea is Cc1nn(C)c(NC(=O)Nc2cccc(F)c2)c1C1=CCCCC1.
What is the InChIKey of 1-[4-(cyclohexen-1-yl)-1,3-dimethylpyrazol-5-yl]-3-(3-fluorophenyl)urea?
The InChIKey is RLMYOQZANYDDEJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H21FN4O/c1-12-16(13-7-4-3-5-8-13)17(23(2)22-12)21-18(24)20-15-10-6-9-14(19)11-15/h6-7,9-11H,3-5,8H2,1-2H3,(H2,20,21,24).
What are the key properties of 1-[4-(cyclohexen-1-yl)-1,3-dimethylpyrazol-5-yl]-3-(3-fluorophenyl)urea?
1-[4-(cyclohexen-1-yl)-1,3-dimethylpyrazol-5-yl]-3-(3-fluorophenyl)urea has a molecular weight of 328.39 g/mol, XLogP of 4.47, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[4-(cyclohexen-1-yl)-1,3-dimethylpyrazol-5-yl]-3-(3-fluorophenyl)urea is sourced from PubChem (CID 22434474), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).