C12H10N2O4 — CID 22435245
8,11a-dihydro-4H-pyridazino[1,2-a]cinnoline-3,6,9,11-tetrone (PubChem CID 22435245) has the molecular formula C12H10N2O4 and a molecular weight of 246.22 g/mol. Its IUPAC name is 8,11a-dihydro-4H-pyridazino[1,2-a]cinnoline-3,6,9,11-tetrone.
| Compound Name | 8,11a-dihydro-4H-pyridazino[1,2-a]cinnoline-3,6,9,11-tetrone |
|---|---|
| PubChem CID | 22435245 |
| Molecular Formula | C12H10N2O4 |
| Molecular Weight | 246.22 g/mol |
| Exact Mass | 246.06 |
| IUPAC Name | 8,11a-dihydro-4H-pyridazino[1,2-a]cinnoline-3,6,9,11-tetrone |
| SMILES | O=C1C=CN2C3C(=O)CC(=O)CC3=CC(=O)N2C1 |
| InChI | InChI=1S/C12H10N2O4/c15-8-1-2-13-12-7(3-9(16)5-10(12)17)4-11(18)14(13)6-8/h1-2,4,12H,3,5-6H2 |
| InChIKey | PGQYYKYGFGWIQA-UHFFFAOYSA-N |
| XLogP | -0.63 |
| TPSA | 74.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.22 |
| LogP ≤ 5 | -0.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|