C12H10F16OS — CID 22436567
4,4,5,5,6,6,7,7,8,8,9,9,10,11,11,11-hexadecafluoro-10-methyl-1-sulfanylundecan-2-ol (PubChem CID 22436567) has the molecular formula C12H10F16OS and a molecular weight of 506.25 g/mol. Its IUPAC name is 4,4,5,5,6,6,7,7,8,8,9,9,10,11,11,11-hexadecafluoro-10-methyl-1-sulfanylundecan-2-ol.
| Compound Name | 4,4,5,5,6,6,7,7,8,8,9,9,10,11,11,11-hexadecafluoro-10-methyl-1-sulfanylundecan-2-ol |
|---|---|
| PubChem CID | 22436567 |
| Molecular Formula | C12H10F16OS |
| Molecular Weight | 506.25 g/mol |
| Exact Mass | 506.02 |
| IUPAC Name | 4,4,5,5,6,6,7,7,8,8,9,9,10,11,11,11-hexadecafluoro-10-methyl-1-sulfanylundecan-2-ol |
| SMILES | CC(F)(C(F)(F)F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)CC(O)CS |
| InChI | InChI=1S/C12H10F16OS/c1-5(13,12(26,27)28)7(16,17)9(20,21)11(24,25)10(22,23)8(18,19)6(14,15)2-4(29)3-30/h4,29-30H,2-3H2,1H3 |
| InChIKey | NTAQLUDSGHIFDP-UHFFFAOYSA-N |
| XLogP | 5.77 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.25 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|