C6H3F11O — CID 22436579
5-(difluoromethoxy)-1,1,1,2,2,3,3,4,4-nonafluoropentane (PubChem CID 22436579) has the molecular formula C6H3F11O and a molecular weight of 300.07 g/mol. Its IUPAC name is 5-(difluoromethoxy)-1,1,1,2,2,3,3,4,4-nonafluoropentane.
| Compound Name | 5-(difluoromethoxy)-1,1,1,2,2,3,3,4,4-nonafluoropentane |
|---|---|
| PubChem CID | 22436579 |
| Molecular Formula | C6H3F11O |
| Molecular Weight | 300.07 g/mol |
| Exact Mass | 300.00 |
| IUPAC Name | 5-(difluoromethoxy)-1,1,1,2,2,3,3,4,4-nonafluoropentane |
| SMILES | FC(F)OCC(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C6H3F11O/c7-2(8)18-1-3(9,10)4(11,12)5(13,14)6(15,16)17/h2H,1H2 |
| InChIKey | MWYPGZOEGJJCBI-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.07 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|