About 3-(benzylamino)oxy-N,N-diethylpropan-1-amine
3-(benzylamino)oxy-N,N-diethylpropan-1-amine (PubChem CID 22436704) has the molecular formula C14H24N2O
and a molecular weight of 236.36 g/mol. Its IUPAC name is 3-(benzylamino)oxy-N,N-diethylpropan-1-amine.
Molecular Properties
| Compound Name | 3-(benzylamino)oxy-N,N-diethylpropan-1-amine |
| PubChem CID | 22436704 |
| Molecular Formula | C14H24N2O |
| Molecular Weight | 236.36 g/mol |
| Exact Mass | 236.19 |
| IUPAC Name | 3-(benzylamino)oxy-N,N-diethylpropan-1-amine |
| SMILES | CCN(CC)CCCONCc1ccccc1 |
| InChI | InChI=1S/C14H24N2O/c1-3-16(4-2)11-8-12-17-15-13-14-9-6-5-7-10-14/h5-7,9-10,15H,3-4,8,11-13H2,1-2H3 |
| InChIKey | QKAZWKJFJUPYOG-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 236.36 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 3-(benzylamino)oxy-N,N-diethylpropan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(benzylamino)oxy-N,N-diethylpropan-1-amine?
The IUPAC name of 3-(benzylamino)oxy-N,N-diethylpropan-1-amine (CID 22436704) is 3-(benzylamino)oxy-N,N-diethylpropan-1-amine.
What is the SMILES notation for 3-(benzylamino)oxy-N,N-diethylpropan-1-amine?
The canonical SMILES for 3-(benzylamino)oxy-N,N-diethylpropan-1-amine is CCN(CC)CCCONCc1ccccc1.
What is the InChIKey of 3-(benzylamino)oxy-N,N-diethylpropan-1-amine?
The InChIKey is QKAZWKJFJUPYOG-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H24N2O/c1-3-16(4-2)11-8-12-17-15-13-14-9-6-5-7-10-14/h5-7,9-10,15H,3-4,8,11-13H2,1-2H3.
What are the key properties of 3-(benzylamino)oxy-N,N-diethylpropan-1-amine?
3-(benzylamino)oxy-N,N-diethylpropan-1-amine has a molecular weight of 236.36 g/mol, XLogP of 2.44, 9 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(benzylamino)oxy-N,N-diethylpropan-1-amine is sourced from PubChem (CID 22436704), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).