About butan-2-yl cyclohexanesulfonate
butan-2-yl cyclohexanesulfonate (PubChem CID 22436780) has the molecular formula C10H20O3S
and a molecular weight of 220.33 g/mol. Its IUPAC name is butan-2-yl cyclohexanesulfonate.
Molecular Properties
| Compound Name | butan-2-yl cyclohexanesulfonate |
| PubChem CID | 22436780 |
| Molecular Formula | C10H20O3S |
| Molecular Weight | 220.33 g/mol |
| Exact Mass | 220.11 |
| IUPAC Name | butan-2-yl cyclohexanesulfonate |
| SMILES | CCC(C)OS(=O)(=O)C1CCCCC1 |
| InChI | InChI=1S/C10H20O3S/c1-3-9(2)13-14(11,12)10-7-5-4-6-8-10/h9-10H,3-8H2,1-2H3 |
| InChIKey | OCTQTMNGBVNHNM-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 220.33 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|
Analyze butan-2-yl cyclohexanesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of butan-2-yl cyclohexanesulfonate?
The IUPAC name of butan-2-yl cyclohexanesulfonate (CID 22436780) is butan-2-yl cyclohexanesulfonate.
What is the SMILES notation for butan-2-yl cyclohexanesulfonate?
The canonical SMILES for butan-2-yl cyclohexanesulfonate is CCC(C)OS(=O)(=O)C1CCCCC1.
What is the InChIKey of butan-2-yl cyclohexanesulfonate?
The InChIKey is OCTQTMNGBVNHNM-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H20O3S/c1-3-9(2)13-14(11,12)10-7-5-4-6-8-10/h9-10H,3-8H2,1-2H3.
What are the key properties of butan-2-yl cyclohexanesulfonate?
butan-2-yl cyclohexanesulfonate has a molecular weight of 220.33 g/mol, XLogP of 2.46, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for butan-2-yl cyclohexanesulfonate is sourced from PubChem (CID 22436780), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).