C29H42N2O4 — CID 22437691
2-tert-butyl-3-(2,3-dimethoxyphenyl)-N-[3-[2-(methylamino)-2-oxoethyl]phenyl]octanamide (PubChem CID 22437691) has the molecular formula C29H42N2O4 and a molecular weight of 482.67 g/mol. Its IUPAC name is 2-tert-butyl-3-(2,3-dimethoxyphenyl)-N-[3-[2-(methylamino)-2-oxoethyl]phenyl]octanamide.
| Compound Name | 2-tert-butyl-3-(2,3-dimethoxyphenyl)-N-[3-[2-(methylamino)-2-oxoethyl]phenyl]octanamide |
|---|---|
| PubChem CID | 22437691 |
| Molecular Formula | C29H42N2O4 |
| Molecular Weight | 482.67 g/mol |
| Exact Mass | 482.31 |
| IUPAC Name | 2-tert-butyl-3-(2,3-dimethoxyphenyl)-N-[3-[2-(methylamino)-2-oxoethyl]phenyl]octanamide |
| SMILES | CCCCCC(c1cccc(OC)c1OC)C(C(=O)Nc1cccc(CC(=O)NC)c1)C(C)(C)C |
| InChI | InChI=1S/C29H42N2O4/c1-8-9-10-15-22(23-16-12-17-24(34-6)27(23)35-7)26(29(2,3)4)28(33)31-21-14-11-13-20(18-21)19-25(32)30-5/h11-14,16-18,22,26H,8-10,15,19H2,1-7H3,(H,30,32)(H,31,33) |
| InChIKey | AQSNJGDHRFRKOS-UHFFFAOYSA-N |
| XLogP | 5.96 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.67 |
| LogP ≤ 5 | 5.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|