About 4-[[4-(3-methyl-2,5-dioxo-1,3-thiazolidin-4-yl)indol-1-yl]methyl]benzoic acid
4-[[4-(3-methyl-2,5-dioxo-1,3-thiazolidin-4-yl)indol-1-yl]methyl]benzoic acid (PubChem CID 22439760) has the molecular formula C20H16N2O4S
and a molecular weight of 380.43 g/mol. Its IUPAC name is 4-[[4-(3-methyl-2,5-dioxo-1,3-thiazolidin-4-yl)indol-1-yl]methyl]benzoic acid.
Molecular Properties
| Compound Name | 4-[[4-(3-methyl-2,5-dioxo-1,3-thiazolidin-4-yl)indol-1-yl]methyl]benzoic acid |
| PubChem CID | 22439760 |
| Molecular Formula | C20H16N2O4S |
| Molecular Weight | 380.43 g/mol |
| Exact Mass | 380.08 |
| IUPAC Name | 4-[[4-(3-methyl-2,5-dioxo-1,3-thiazolidin-4-yl)indol-1-yl]methyl]benzoic acid |
| SMILES | CN1C(=O)SC(=O)C1c1cccc2c1ccn2Cc1ccc(C(=O)O)cc1 |
| InChI | InChI=1S/C20H16N2O4S/c1-21-17(19(25)27-20(21)26)15-3-2-4-16-14(15)9-10-22(16)11-12-5-7-13(8-6-12)18(23)24/h2-10,17H,11H2,1H3,(H,23,24) |
| InChIKey | JOFNCLNGFZJAIS-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 79.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 380.43 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|
Analyze 4-[[4-(3-methyl-2,5-dioxo-1,3-thiazolidin-4-yl)indol-1-yl]methyl]benzoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[[4-(3-methyl-2,5-dioxo-1,3-thiazolidin-4-yl)indol-1-yl]methyl]benzoic acid?
The IUPAC name of 4-[[4-(3-methyl-2,5-dioxo-1,3-thiazolidin-4-yl)indol-1-yl]methyl]benzoic acid (CID 22439760) is 4-[[4-(3-methyl-2,5-dioxo-1,3-thiazolidin-4-yl)indol-1-yl]methyl]benzoic acid.
What is the SMILES notation for 4-[[4-(3-methyl-2,5-dioxo-1,3-thiazolidin-4-yl)indol-1-yl]methyl]benzoic acid?
The canonical SMILES for 4-[[4-(3-methyl-2,5-dioxo-1,3-thiazolidin-4-yl)indol-1-yl]methyl]benzoic acid is CN1C(=O)SC(=O)C1c1cccc2c1ccn2Cc1ccc(C(=O)O)cc1.
What is the InChIKey of 4-[[4-(3-methyl-2,5-dioxo-1,3-thiazolidin-4-yl)indol-1-yl]methyl]benzoic acid?
The InChIKey is JOFNCLNGFZJAIS-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H16N2O4S/c1-21-17(19(25)27-20(21)26)15-3-2-4-16-14(15)9-10-22(16)11-12-5-7-13(8-6-12)18(23)24/h2-10,17H,11H2,1H3,(H,23,24).
What are the key properties of 4-[[4-(3-methyl-2,5-dioxo-1,3-thiazolidin-4-yl)indol-1-yl]methyl]benzoic acid?
4-[[4-(3-methyl-2,5-dioxo-1,3-thiazolidin-4-yl)indol-1-yl]methyl]benzoic acid has a molecular weight of 380.43 g/mol, XLogP of 3.75, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[[4-(3-methyl-2,5-dioxo-1,3-thiazolidin-4-yl)indol-1-yl]methyl]benzoic acid is sourced from PubChem (CID 22439760), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).