C21H18N2O4S — CID 22439825
3-[1-[(3,4-dimethoxyphenyl)methyl]indol-4-yl]-4-methylidene-1,3-thiazolidine-2,5-dione (PubChem CID 22439825) has the molecular formula C21H18N2O4S and a molecular weight of 394.45 g/mol. Its IUPAC name is 3-[1-[(3,4-dimethoxyphenyl)methyl]indol-4-yl]-4-methylidene-1,3-thiazolidine-2,5-dione.
| Compound Name | 3-[1-[(3,4-dimethoxyphenyl)methyl]indol-4-yl]-4-methylidene-1,3-thiazolidine-2,5-dione |
|---|---|
| PubChem CID | 22439825 |
| Molecular Formula | C21H18N2O4S |
| Molecular Weight | 394.45 g/mol |
| Exact Mass | 394.10 |
| IUPAC Name | 3-[1-[(3,4-dimethoxyphenyl)methyl]indol-4-yl]-4-methylidene-1,3-thiazolidine-2,5-dione |
| SMILES | C=C1C(=O)SC(=O)N1c1cccc2c1ccn2Cc1ccc(OC)c(OC)c1 |
| InChI | InChI=1S/C21H18N2O4S/c1-13-20(24)28-21(25)23(13)17-6-4-5-16-15(17)9-10-22(16)12-14-7-8-18(26-2)19(11-14)27-3/h4-11H,1,12H2,2-3H3 |
| InChIKey | BYKDZZWFPIPPPJ-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 60.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.45 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|