C24H50N4 — CID 22440086
1,1-bis(2,2,6,6-tetramethylpiperidin-4-yl)hexylhydrazine (PubChem CID 22440086) has the molecular formula C24H50N4 and a molecular weight of 394.69 g/mol. Its IUPAC name is 1,1-bis(2,2,6,6-tetramethylpiperidin-4-yl)hexylhydrazine.
| Compound Name | 1,1-bis(2,2,6,6-tetramethylpiperidin-4-yl)hexylhydrazine |
|---|---|
| PubChem CID | 22440086 |
| Molecular Formula | C24H50N4 |
| Molecular Weight | 394.69 g/mol |
| Exact Mass | 394.40 |
| IUPAC Name | 1,1-bis(2,2,6,6-tetramethylpiperidin-4-yl)hexylhydrazine |
| SMILES | CCCCCC(NN)(C1CC(C)(C)NC(C)(C)C1)C1CC(C)(C)NC(C)(C)C1 |
| InChI | InChI=1S/C24H50N4/c1-10-11-12-13-24(28-25,18-14-20(2,3)26-21(4,5)15-18)19-16-22(6,7)27-23(8,9)17-19/h18-19,26-28H,10-17,25H2,1-9H3 |
| InChIKey | WIMUSNQGQLZGRU-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 62.11 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.69 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|