C13H12F3N3O4 — CID 2244016
5-[1-(2-hydroxyethyl)-2-methyl-6-(trifluoromethyl)-4-pyridinylidene]-1,3-diazinane-2,4,6-trione (PubChem CID 2244016) has the molecular formula C13H12F3N3O4 and a molecular weight of 331.25 g/mol. Its IUPAC name is 5-[1-(2-hydroxyethyl)-2-methyl-6-(trifluoromethyl)-4-pyridinylidene]-1,3-diazinane-2,4,6-trione.
| Compound Name | 5-[1-(2-hydroxyethyl)-2-methyl-6-(trifluoromethyl)-4-pyridinylidene]-1,3-diazinane-2,4,6-trione |
|---|---|
| PubChem CID | 2244016 |
| Molecular Formula | C13H12F3N3O4 |
| Molecular Weight | 331.25 g/mol |
| Exact Mass | 331.08 |
| IUPAC Name | 5-[1-(2-hydroxyethyl)-2-methyl-6-(trifluoromethyl)-4-pyridinylidene]-1,3-diazinane-2,4,6-trione |
| SMILES | CC1=CC(=C2C(=O)NC(=O)NC2=O)C=C(C(F)(F)F)N1CCO |
| InChI | InChI=1S/C13H12F3N3O4/c1-6-4-7(9-10(21)17-12(23)18-11(9)22)5-8(13(14,15)16)19(6)2-3-20/h4-5,20H,2-3H2,1H3,(H2,17,18,21,22,23) |
| InChIKey | BJTAIHBOCZLCCU-UHFFFAOYSA-N |
| XLogP | 0.31 |
| TPSA | 98.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.25 |
| LogP ≤ 5 | 0.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|