About 2-(diethylamino)ethyl 2-methyl-5-nitrobenzenesulfonate
2-(diethylamino)ethyl 2-methyl-5-nitrobenzenesulfonate (PubChem CID 2244180) has the molecular formula C13H20N2O5S
and a molecular weight of 316.38 g/mol. Its IUPAC name is 2-(diethylamino)ethyl 2-methyl-5-nitrobenzenesulfonate.
Molecular Properties
| Compound Name | 2-(diethylamino)ethyl 2-methyl-5-nitrobenzenesulfonate |
| PubChem CID | 2244180 |
| Molecular Formula | C13H20N2O5S |
| Molecular Weight | 316.38 g/mol |
| Exact Mass | 316.11 |
| IUPAC Name | 2-(diethylamino)ethyl 2-methyl-5-nitrobenzenesulfonate |
| SMILES | CCN(CC)CCOS(=O)(=O)c1cc([N+](=O)[O-])ccc1C |
| InChI | InChI=1S/C13H20N2O5S/c1-4-14(5-2)8-9-20-21(18,19)13-10-12(15(16)17)7-6-11(13)3/h6-7,10H,4-5,8-9H2,1-3H3 |
| InChIKey | APSSVKAWSGYEKQ-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 89.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 316.38 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|
Analyze 2-(diethylamino)ethyl 2-methyl-5-nitrobenzenesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(diethylamino)ethyl 2-methyl-5-nitrobenzenesulfonate?
The IUPAC name of 2-(diethylamino)ethyl 2-methyl-5-nitrobenzenesulfonate (CID 2244180) is 2-(diethylamino)ethyl 2-methyl-5-nitrobenzenesulfonate.
What is the SMILES notation for 2-(diethylamino)ethyl 2-methyl-5-nitrobenzenesulfonate?
The canonical SMILES for 2-(diethylamino)ethyl 2-methyl-5-nitrobenzenesulfonate is CCN(CC)CCOS(=O)(=O)c1cc([N+](=O)[O-])ccc1C.
What is the InChIKey of 2-(diethylamino)ethyl 2-methyl-5-nitrobenzenesulfonate?
The InChIKey is APSSVKAWSGYEKQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H20N2O5S/c1-4-14(5-2)8-9-20-21(18,19)13-10-12(15(16)17)7-6-11(13)3/h6-7,10H,4-5,8-9H2,1-3H3.
What are the key properties of 2-(diethylamino)ethyl 2-methyl-5-nitrobenzenesulfonate?
2-(diethylamino)ethyl 2-methyl-5-nitrobenzenesulfonate has a molecular weight of 316.38 g/mol, XLogP of 1.95, 8 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(diethylamino)ethyl 2-methyl-5-nitrobenzenesulfonate is sourced from PubChem (CID 2244180), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).