About [[tris(dimethylamino)-λ5-phosphanylidene]amino]phosphanium chloride
[[tris(dimethylamino)-λ5-phosphanylidene]amino]phosphanium chloride (PubChem CID 22442079) has the molecular formula C6H21ClN4P2
and a molecular weight of 246.66 g/mol. Its IUPAC name is [[tris(dimethylamino)-λ5-phosphanylidene]amino]phosphanium chloride.
Molecular Properties
| Compound Name | [[tris(dimethylamino)-λ5-phosphanylidene]amino]phosphanium chloride |
| PubChem CID | 22442079 |
| Molecular Formula | C6H21ClN4P2 |
| Molecular Weight | 246.66 g/mol |
| Exact Mass | 246.09 |
| IUPAC Name | [[tris(dimethylamino)-λ5-phosphanylidene]amino]phosphanium chloride |
| SMILES | CN(C)P(=N[PH3+])(N(C)C)N(C)C.[Cl-] |
| InChI | InChI=1S/C6H20N4P2.ClH/c1-8(2)12(7-11,9(3)4)10(5)6;/h11H2,1-6H3;1H |
| InChIKey | YFARCPCCIYZOLF-UHFFFAOYSA-N |
| XLogP | -1.86 |
| TPSA | 22.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 246.66 |
| LogP ≤ 5 | -1.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze [[tris(dimethylamino)-λ5-phosphanylidene]amino]phosphanium chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [[tris(dimethylamino)-λ5-phosphanylidene]amino]phosphanium chloride?
The IUPAC name of [[tris(dimethylamino)-λ5-phosphanylidene]amino]phosphanium chloride (CID 22442079) is [[tris(dimethylamino)-λ5-phosphanylidene]amino]phosphanium chloride.
What is the SMILES notation for [[tris(dimethylamino)-λ5-phosphanylidene]amino]phosphanium chloride?
The canonical SMILES for [[tris(dimethylamino)-λ5-phosphanylidene]amino]phosphanium chloride is CN(C)P(=N[PH3+])(N(C)C)N(C)C.[Cl-].
What is the InChIKey of [[tris(dimethylamino)-λ5-phosphanylidene]amino]phosphanium chloride?
The InChIKey is YFARCPCCIYZOLF-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H20N4P2.ClH/c1-8(2)12(7-11,9(3)4)10(5)6;/h11H2,1-6H3;1H.
What are the key properties of [[tris(dimethylamino)-λ5-phosphanylidene]amino]phosphanium chloride?
[[tris(dimethylamino)-λ5-phosphanylidene]amino]phosphanium chloride has a molecular weight of 246.66 g/mol, XLogP of -1.86, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for [[tris(dimethylamino)-λ5-phosphanylidene]amino]phosphanium chloride is sourced from PubChem (CID 22442079), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).