About (2Z)-2-[(4-morpholin-4-ylphenyl)methylidene]-[1,3]thiazolo[3,2-a]benzimidazol-1-one
(2Z)-2-[(4-morpholin-4-ylphenyl)methylidene]-[1,3]thiazolo[3,2-a]benzimidazol-1-one (PubChem CID 2244222) has the molecular formula C20H17N3O2S
and a molecular weight of 363.44 g/mol. Its IUPAC name is (2Z)-2-[(4-morpholin-4-ylphenyl)methylidene]-[1,3]thiazolo[3,2-a]benzimidazol-1-one.
Molecular Properties
| Compound Name | (2Z)-2-[(4-morpholin-4-ylphenyl)methylidene]-[1,3]thiazolo[3,2-a]benzimidazol-1-one |
| PubChem CID | 2244222 |
| Molecular Formula | C20H17N3O2S |
| Molecular Weight | 363.44 g/mol |
| Exact Mass | 363.10 |
| IUPAC Name | (2Z)-2-[(4-morpholin-4-ylphenyl)methylidene]-[1,3]thiazolo[3,2-a]benzimidazol-1-one |
| SMILES | O=c1/c(=C/c2ccc(N3CCOCC3)cc2)sc2nc3ccccc3n12 |
| InChI | InChI=1S/C20H17N3O2S/c24-19-18(26-20-21-16-3-1-2-4-17(16)23(19)20)13-14-5-7-15(8-6-14)22-9-11-25-12-10-22/h1-8,13H,9-12H2/b18-13- |
| InChIKey | DWOYWRKVKGTEBA-AQTBWJFISA-N |
| XLogP | 2.29 |
| TPSA | 46.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 363.44 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'} |
|---|
Analyze (2Z)-2-[(4-morpholin-4-ylphenyl)methylidene]-[1,3]thiazolo[3,2-a]benzimidazol-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2Z)-2-[(4-morpholin-4-ylphenyl)methylidene]-[1,3]thiazolo[3,2-a]benzimidazol-1-one?
The IUPAC name of (2Z)-2-[(4-morpholin-4-ylphenyl)methylidene]-[1,3]thiazolo[3,2-a]benzimidazol-1-one (CID 2244222) is (2Z)-2-[(4-morpholin-4-ylphenyl)methylidene]-[1,3]thiazolo[3,2-a]benzimidazol-1-one.
What is the SMILES notation for (2Z)-2-[(4-morpholin-4-ylphenyl)methylidene]-[1,3]thiazolo[3,2-a]benzimidazol-1-one?
The canonical SMILES for (2Z)-2-[(4-morpholin-4-ylphenyl)methylidene]-[1,3]thiazolo[3,2-a]benzimidazol-1-one is O=c1/c(=C/c2ccc(N3CCOCC3)cc2)sc2nc3ccccc3n12.
What is the InChIKey of (2Z)-2-[(4-morpholin-4-ylphenyl)methylidene]-[1,3]thiazolo[3,2-a]benzimidazol-1-one?
The InChIKey is DWOYWRKVKGTEBA-AQTBWJFISA-N. The full InChI is InChI=1S/C20H17N3O2S/c24-19-18(26-20-21-16-3-1-2-4-17(16)23(19)20)13-14-5-7-15(8-6-14)22-9-11-25-12-10-22/h1-8,13H,9-12H2/b18-13-.
What are the key properties of (2Z)-2-[(4-morpholin-4-ylphenyl)methylidene]-[1,3]thiazolo[3,2-a]benzimidazol-1-one?
(2Z)-2-[(4-morpholin-4-ylphenyl)methylidene]-[1,3]thiazolo[3,2-a]benzimidazol-1-one has a molecular weight of 363.44 g/mol, XLogP of 2.29, 2 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for (2Z)-2-[(4-morpholin-4-ylphenyl)methylidene]-[1,3]thiazolo[3,2-a]benzimidazol-1-one is sourced from PubChem (CID 2244222), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).