About 7-[(trifluoromethylsulfonylamino)methyl]naphthalene-2-carboximidamide;dihydrochloride
7-[(trifluoromethylsulfonylamino)methyl]naphthalene-2-carboximidamide;dihydrochloride (PubChem CID 22443085) has the molecular formula C13H14Cl2F3N3O2S
and a molecular weight of 404.24 g/mol. Its IUPAC name is 7-[(trifluoromethylsulfonylamino)methyl]naphthalene-2-carboximidamide;dihydrochloride.
Molecular Properties
| Compound Name | 7-[(trifluoromethylsulfonylamino)methyl]naphthalene-2-carboximidamide;dihydrochloride |
| PubChem CID | 22443085 |
| Molecular Formula | C13H14Cl2F3N3O2S |
| Molecular Weight | 404.24 g/mol |
| Exact Mass | 403.01 |
| IUPAC Name | 7-[(trifluoromethylsulfonylamino)methyl]naphthalene-2-carboximidamide;dihydrochloride |
| SMILES | Cl.Cl.[H]/N=C(\N)c1ccc2ccc(CNS(=O)(=O)C(F)(F)F)cc2c1 |
| InChI | InChI=1S/C13H12F3N3O2S.2ClH/c14-13(15,16)22(20,21)19-7-8-1-2-9-3-4-10(12(17)18)6-11(9)5-8;;/h1-6,19H,7H2,(H3,17,18);2*1H |
| InChIKey | CYRJAZKHJNMQNV-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 96.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 404.24 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 7-[(trifluoromethylsulfonylamino)methyl]naphthalene-2-carboximidamide;dihydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-[(trifluoromethylsulfonylamino)methyl]naphthalene-2-carboximidamide;dihydrochloride?
The IUPAC name of 7-[(trifluoromethylsulfonylamino)methyl]naphthalene-2-carboximidamide;dihydrochloride (CID 22443085) is 7-[(trifluoromethylsulfonylamino)methyl]naphthalene-2-carboximidamide;dihydrochloride.
What is the SMILES notation for 7-[(trifluoromethylsulfonylamino)methyl]naphthalene-2-carboximidamide;dihydrochloride?
The canonical SMILES for 7-[(trifluoromethylsulfonylamino)methyl]naphthalene-2-carboximidamide;dihydrochloride is Cl.Cl.[H]/N=C(\N)c1ccc2ccc(CNS(=O)(=O)C(F)(F)F)cc2c1.
What is the InChIKey of 7-[(trifluoromethylsulfonylamino)methyl]naphthalene-2-carboximidamide;dihydrochloride?
The InChIKey is CYRJAZKHJNMQNV-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H12F3N3O2S.2ClH/c14-13(15,16)22(20,21)19-7-8-1-2-9-3-4-10(12(17)18)6-11(9)5-8;;/h1-6,19H,7H2,(H3,17,18);2*1H.
What are the key properties of 7-[(trifluoromethylsulfonylamino)methyl]naphthalene-2-carboximidamide;dihydrochloride?
7-[(trifluoromethylsulfonylamino)methyl]naphthalene-2-carboximidamide;dihydrochloride has a molecular weight of 404.24 g/mol, XLogP of 2.91, 4 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 7-[(trifluoromethylsulfonylamino)methyl]naphthalene-2-carboximidamide;dihydrochloride is sourced from PubChem (CID 22443085), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).