C31H59N — CID 22443858
N-decyl-N-[1-(2,3,4,5-tetramethylcyclopenta-1,3-dien-1-yl)ethyl]decan-1-amine (PubChem CID 22443858) has the molecular formula C31H59N and a molecular weight of 445.82 g/mol. Its IUPAC name is N-decyl-N-[1-(2,3,4,5-tetramethylcyclopenta-1,3-dien-1-yl)ethyl]decan-1-amine.
| Compound Name | N-decyl-N-[1-(2,3,4,5-tetramethylcyclopenta-1,3-dien-1-yl)ethyl]decan-1-amine |
|---|---|
| PubChem CID | 22443858 |
| Molecular Formula | C31H59N |
| Molecular Weight | 445.82 g/mol |
| Exact Mass | 445.46 |
| IUPAC Name | N-decyl-N-[1-(2,3,4,5-tetramethylcyclopenta-1,3-dien-1-yl)ethyl]decan-1-amine |
| SMILES | CCCCCCCCCCN(CCCCCCCCCC)C(C)C1=C(C)C(C)=C(C)C1C |
| InChI | InChI=1S/C31H59N/c1-8-10-12-14-16-18-20-22-24-32(25-23-21-19-17-15-13-11-9-2)30(7)31-28(5)26(3)27(4)29(31)6/h28,30H,8-25H2,1-7H3 |
| InChIKey | FWOHTVVWDPLEHN-UHFFFAOYSA-N |
| XLogP | 10.26 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.82 |
| LogP ≤ 5 | 10.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|