C18H25F3O2 — CID 22444604
3a-methyl-3-(7,7,7-trifluoro-6-hydroxy-6-methylhept-4-yn-2-yl)-3,4,5,6,7,7a-hexahydroinden-4-ol (PubChem CID 22444604) has the molecular formula C18H25F3O2 and a molecular weight of 330.39 g/mol. Its IUPAC name is 3a-methyl-3-(7,7,7-trifluoro-6-hydroxy-6-methylhept-4-yn-2-yl)-3,4,5,6,7,7a-hexahydroinden-4-ol.
| Compound Name | 3a-methyl-3-(7,7,7-trifluoro-6-hydroxy-6-methylhept-4-yn-2-yl)-3,4,5,6,7,7a-hexahydroinden-4-ol |
|---|---|
| PubChem CID | 22444604 |
| Molecular Formula | C18H25F3O2 |
| Molecular Weight | 330.39 g/mol |
| Exact Mass | 330.18 |
| IUPAC Name | 3a-methyl-3-(7,7,7-trifluoro-6-hydroxy-6-methylhept-4-yn-2-yl)-3,4,5,6,7,7a-hexahydroinden-4-ol |
| SMILES | CC(CC#CC(C)(O)C(F)(F)F)C1C=CC2CCCC(O)C21C |
| InChI | InChI=1S/C18H25F3O2/c1-12(6-5-11-16(2,23)18(19,20)21)14-10-9-13-7-4-8-15(22)17(13,14)3/h9-10,12-15,22-23H,4,6-8H2,1-3H3 |
| InChIKey | BHJBFICDESUXML-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.39 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|