C18H25F3O2 — CID 22444605
7a-methyl-1-(7,7,7-trifluoro-6-hydroxy-6-methylhept-4-yn-2-yl)-3,3a,4,5,6,7-hexahydroinden-4-ol (PubChem CID 22444605) has the molecular formula C18H25F3O2 and a molecular weight of 330.39 g/mol. Its IUPAC name is 7a-methyl-1-(7,7,7-trifluoro-6-hydroxy-6-methylhept-4-yn-2-yl)-3,3a,4,5,6,7-hexahydroinden-4-ol.
| Compound Name | 7a-methyl-1-(7,7,7-trifluoro-6-hydroxy-6-methylhept-4-yn-2-yl)-3,3a,4,5,6,7-hexahydroinden-4-ol |
|---|---|
| PubChem CID | 22444605 |
| Molecular Formula | C18H25F3O2 |
| Molecular Weight | 330.39 g/mol |
| Exact Mass | 330.18 |
| IUPAC Name | 7a-methyl-1-(7,7,7-trifluoro-6-hydroxy-6-methylhept-4-yn-2-yl)-3,3a,4,5,6,7-hexahydroinden-4-ol |
| SMILES | CC(CC#CC(C)(O)C(F)(F)F)C1=CCC2C(O)CCCC12C |
| InChI | InChI=1S/C18H25F3O2/c1-12(6-4-11-17(3,23)18(19,20)21)13-8-9-14-15(22)7-5-10-16(13,14)2/h8,12,14-15,22-23H,5-7,9-10H2,1-3H3 |
| InChIKey | LQHKVDFMZALPOB-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.39 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|