C18H32O2 — CID 22444616
1-(6-hydroxy-6-methylheptan-2-yl)-7a-methyl-3,3a,4,5,6,7-hexahydroinden-4-ol (PubChem CID 22444616) has the molecular formula C18H32O2 and a molecular weight of 280.45 g/mol. Its IUPAC name is 1-(6-hydroxy-6-methylheptan-2-yl)-7a-methyl-3,3a,4,5,6,7-hexahydroinden-4-ol.
| Compound Name | 1-(6-hydroxy-6-methylheptan-2-yl)-7a-methyl-3,3a,4,5,6,7-hexahydroinden-4-ol |
|---|---|
| PubChem CID | 22444616 |
| Molecular Formula | C18H32O2 |
| Molecular Weight | 280.45 g/mol |
| Exact Mass | 280.24 |
| IUPAC Name | 1-(6-hydroxy-6-methylheptan-2-yl)-7a-methyl-3,3a,4,5,6,7-hexahydroinden-4-ol |
| SMILES | CC(CCCC(C)(C)O)C1=CCC2C(O)CCCC12C |
| InChI | InChI=1S/C18H32O2/c1-13(7-5-11-17(2,3)20)14-9-10-15-16(19)8-6-12-18(14,15)4/h9,13,15-16,19-20H,5-8,10-12H2,1-4H3 |
| InChIKey | RYGIJRHMIZRWQS-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.45 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|