About 1,2-dimethylpiperazine;prop-2-enamide
1,2-dimethylpiperazine;prop-2-enamide (PubChem CID 22444655) has the molecular formula C9H19N3O
and a molecular weight of 185.27 g/mol. Its IUPAC name is 1,2-dimethylpiperazine;prop-2-enamide.
Molecular Properties
| Compound Name | 1,2-dimethylpiperazine;prop-2-enamide |
| PubChem CID | 22444655 |
| Molecular Formula | C9H19N3O |
| Molecular Weight | 185.27 g/mol |
| Exact Mass | 185.15 |
| IUPAC Name | 1,2-dimethylpiperazine;prop-2-enamide |
| SMILES | C=CC(N)=O.CC1CNCCN1C |
| InChI | InChI=1S/C6H14N2.C3H5NO/c1-6-5-7-3-4-8(6)2;1-2-3(4)5/h6-7H,3-5H2,1-2H3;2H,1H2,(H2,4,5) |
| InChIKey | OZPMMXTZHLLYQY-UHFFFAOYSA-N |
| XLogP | -0.43 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 185.27 |
| LogP ≤ 5 | -0.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 1,2-dimethylpiperazine;prop-2-enamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,2-dimethylpiperazine;prop-2-enamide?
The IUPAC name of 1,2-dimethylpiperazine;prop-2-enamide (CID 22444655) is 1,2-dimethylpiperazine;prop-2-enamide.
What is the SMILES notation for 1,2-dimethylpiperazine;prop-2-enamide?
The canonical SMILES for 1,2-dimethylpiperazine;prop-2-enamide is C=CC(N)=O.CC1CNCCN1C.
What is the InChIKey of 1,2-dimethylpiperazine;prop-2-enamide?
The InChIKey is OZPMMXTZHLLYQY-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H14N2.C3H5NO/c1-6-5-7-3-4-8(6)2;1-2-3(4)5/h6-7H,3-5H2,1-2H3;2H,1H2,(H2,4,5).
What are the key properties of 1,2-dimethylpiperazine;prop-2-enamide?
1,2-dimethylpiperazine;prop-2-enamide has a molecular weight of 185.27 g/mol, XLogP of -0.43, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1,2-dimethylpiperazine;prop-2-enamide is sourced from PubChem (CID 22444655), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).