About ethyl cyclohexa-2,4-diene-1-carboxylate
ethyl cyclohexa-2,4-diene-1-carboxylate (PubChem CID 22445354) has the molecular formula C9H12O2
and a molecular weight of 152.19 g/mol. Its IUPAC name is ethyl cyclohexa-2,4-diene-1-carboxylate.
Molecular Properties
| Compound Name | ethyl cyclohexa-2,4-diene-1-carboxylate |
| PubChem CID | 22445354 |
| Molecular Formula | C9H12O2 |
| Molecular Weight | 152.19 g/mol |
| Exact Mass | 152.08 |
| IUPAC Name | ethyl cyclohexa-2,4-diene-1-carboxylate |
| SMILES | CCOC(=O)C1C=CC=CC1 |
| InChI | InChI=1S/C9H12O2/c1-2-11-9(10)8-6-4-3-5-7-8/h3-6,8H,2,7H2,1H3 |
| InChIKey | VPUMROAOIHYSPB-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 152.19 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze ethyl cyclohexa-2,4-diene-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl cyclohexa-2,4-diene-1-carboxylate?
The IUPAC name of ethyl cyclohexa-2,4-diene-1-carboxylate (CID 22445354) is ethyl cyclohexa-2,4-diene-1-carboxylate.
What is the SMILES notation for ethyl cyclohexa-2,4-diene-1-carboxylate?
The canonical SMILES for ethyl cyclohexa-2,4-diene-1-carboxylate is CCOC(=O)C1C=CC=CC1.
What is the InChIKey of ethyl cyclohexa-2,4-diene-1-carboxylate?
The InChIKey is VPUMROAOIHYSPB-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12O2/c1-2-11-9(10)8-6-4-3-5-7-8/h3-6,8H,2,7H2,1H3.
What are the key properties of ethyl cyclohexa-2,4-diene-1-carboxylate?
ethyl cyclohexa-2,4-diene-1-carboxylate has a molecular weight of 152.19 g/mol, XLogP of 1.68, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl cyclohexa-2,4-diene-1-carboxylate is sourced from PubChem (CID 22445354), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).